id
int64 0
402
| molecules
dict | ground_truth
stringlengths 13
162
| messages
listlengths 3
3
|
|---|---|---|---|
281
|
{
"selfies": [
"[C][#C][C][=C][C][Branch1][=Branch2][C][O][C][C][C][O][Ring1][=Branch1][=C][O][C][=C][C][Ring1][Branch1][=C][Ring1][#C]"
],
"smiles": [
"C#Cc1cc(C2OCCCO2)c2occc2c1"
]
}
|
C[Si](C)(C)C#Cc1cc(C2OCCCO2)c2occc2c1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>",
"role": "user"
},
{
"content": "C[Si](C)(C)C#Cc1cc(C2OCCCO2)c2occc2c1",
"role": "assistant"
}
] |
282
|
{
"selfies": [
"[C][=C][Branch2][Ring2][S][C][=Branch1][C][=O][N][C][C][=C][C][Branch2][Ring1][Ring2][C][=C][C][=C][Branch1][#Branch2][O][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][O][=N][C][Branch1][=Branch2][N][C][C][O][C][C][Ring1][=Branch1][=C][Ring2][Ring1][#Branch1][N][Branch1][C][C][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1]"
],
"smiles": [
"C=C(C(=O)NCc1cc(-c2ccc(OC(F)(F)F)cc2)nc(N2CCOCC2)c1)N(C)S(=O)(=O)c1ccc(Cl)cc1"
]
}
|
C=C(C(=O)O)N(C)S(=O)(=O)c1ccc(Cl)cc1.NCc1cc(-c2ccc(OC(F)(F)F)cc2)nc(N2CCOCC2)c1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>",
"role": "user"
},
{
"content": "C=C(C(=O)O)N(C)S(=O)(=O)c1ccc(Cl)cc1.NCc1cc(-c2ccc(OC(F)(F)F)cc2)nc(N2CCOCC2)c1",
"role": "assistant"
}
] |
283
|
{
"selfies": [
"[O][=C][Branch1][N][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][N][C][C][Branch1][C][O][C][Branch2][Ring1][#Branch1][N][C][C][N][Branch1][=N][C][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][C][Ring1][=C][C][Ring2][Ring1][Ring2]"
],
"smiles": [
"O=C(c1ccc(Cl)cc1)N1CC(O)C(N2CCN(Cc3ccc(Cl)cc3)CC2)C1"
]
}
|
O=C(c1ccc(Cl)cc1)N1CC(O)C(N2CCNCC2)C1.O=Cc1ccc(Cl)cc1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.",
"role": "user"
},
{
"content": "Here are possible reactants: O=C(c1ccc(Cl)cc1)N1CC(O)C(N2CCNCC2)C1.O=Cc1ccc(Cl)cc1 .",
"role": "assistant"
}
] |
284
|
{
"selfies": [
"[C][O][C][=C][C][=C][Branch2][Ring2][#Branch2][C][O][C][=C][C][=C][Branch2][Ring1][#Branch2][C][=C][N][=C][NH1][C][=C][Branch1][O][C][=C][C][=C][C][=C][Ring1][=Branch1][O][C][C][Ring1][=N][=C][Ring1][P][C][=C][Ring2][Ring1][#Branch1][O][C][C][=C][Ring2][Ring1][P]"
],
"smiles": [
"COc1ccc(COc2ccc(-c3cnc4[nH]cc(-c5ccccc5OC)c4c3)cc2OC)cc1"
]
}
|
COc1ccc(COc2ccc(B3OC(C)(C)C(C)(C)O3)cc2OC)cc1.COc1ccccc1-c1c[nH]c2ncc(Br)cc12
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?",
"role": "user"
},
{
"content": "COc1ccc(COc2ccc(B3OC(C)(C)C(C)(C)O3)cc2OC)cc1.COc1ccccc1-c1c[nH]c2ncc(Br)cc12",
"role": "assistant"
}
] |
285
|
{
"selfies": [
"[O][=C][Branch2][Ring1][#Branch1][C][C][=N][C][Branch1][=Branch2][N][C][C][O][C][C][Ring1][=Branch1][=C][C][=Branch1][C][=O][NH1][Ring1][=N][N][C][=C][C][=C][C][Branch1][=Branch1][C][C][C][Ring1][Ring1][=C][Ring1][=Branch2]"
],
"smiles": [
"O=C(Cc1nc(N2CCOCC2)cc(=O)[nH]1)Nc1cccc(C2CC2)c1"
]
}
|
Nc1cccc(C2CC2)c1.O=C([O-])Cc1nc(N2CCOCC2)cc(=O)[nH]1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>",
"role": "user"
},
{
"content": "Nc1cccc(C2CC2)c1.O=C([O-])Cc1nc(N2CCOCC2)cc(=O)[nH]1",
"role": "assistant"
}
] |
286
|
{
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][C][C][N][C][Branch2][Ring1][=Branch2][C][=Branch1][C][=O][N][C][C][=C][C][=C][Branch1][=Branch2][N][C][C][C][C][Ring1][Branch1][=O][C][=C][Ring1][N][C][Branch1][N][C][=C][C][=C][C][Branch1][C][Cl][=C][Ring1][#Branch1][C][Ring2][Ring1][N][Branch1][Ring1][C][#N][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1]"
],
"smiles": [
"CC(C)(C)CC1NC(C(=O)NCc2ccc(N3CCCC3=O)cc2)C(c2cccc(Cl)c2)C1(C#N)c1ccc(Cl)cc1"
]
}
|
CC(C)(C)CC1NC(C(=O)O)C(c2cccc(Cl)c2)C1(C#N)c1ccc(Cl)cc1.NCc1ccc(N2CCCC2=O)cc1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Given the following product, please provide possible reactants. <molecule_2d>",
"role": "user"
},
{
"content": "Possible reactant(s): CC(C)(C)CC1NC(C(=O)O)C(c2cccc(Cl)c2)C1(C#N)c1ccc(Cl)cc1.NCc1ccc(N2CCCC2=O)cc1 .",
"role": "assistant"
}
] |
287
|
{
"selfies": [
"[O][=C][Branch1][=C][C][=C][C][=C][NH1][N][=N][C][Ring1][Branch1][=C][Ring1][=Branch2][N][C][C][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][C][Ring1][#Branch2][Ring1][=C]"
],
"smiles": [
"O=C(c1ccc2[nH]nnc2c1)N1CCCC2c3ccccc3CCC21"
]
}
|
O=C(O)c1ccc2[nH]nnc2c1.c1ccc2c(c1)CCC1NCCCC21
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?",
"role": "user"
},
{
"content": "O=C(O)c1ccc2[nH]nnc2c1.c1ccc2c(c1)CCC1NCCCC21",
"role": "assistant"
}
] |
288
|
{
"selfies": [
"[O][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][Branch1][C][Cl][=C][C][=C][Ring1][#Branch1][N][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][C][Br][C][=C][Ring1][#Branch1]"
],
"smiles": [
"O=C(c1ccccc1)c1cc(Cl)ccc1NS(=O)(=O)c1ccc(Br)cc1"
]
}
|
Nc1ccc(Cl)cc1C(=O)c1ccccc1.O=S(=O)(Cl)c1ccc(Br)cc1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Given the following product, please provide possible reactants. <molecule_2d>",
"role": "user"
},
{
"content": "Possible reactant(s): Nc1ccc(Cl)cc1C(=O)c1ccccc1.O=S(=O)(Cl)c1ccc(Br)cc1 .",
"role": "assistant"
}
] |
289
|
{
"selfies": [
"[C][C][N][N][=C][Branch1][N][C][=C][C][=C][Branch1][C][O][N][=C][Ring1][#Branch1][C][=N][C][=C][C][=C][Ring1][=Branch1][Ring1][S]"
],
"smiles": [
"CCn1nc(-c2ccc(O)nc2)c2ncccc21"
]
}
|
CCn1nc(-c2ccc(OC)nc2)c2ncccc21
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .",
"role": "user"
},
{
"content": "The potential reactants: CCn1nc(-c2ccc(OC)nc2)c2ncccc21 .",
"role": "assistant"
}
] |
290
|
{
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][=C][N][Branch2][Ring1][Ring1][C][=C][C][Branch1][C][N][=C][Branch1][C][F][C][Branch1][C][F][=C][Ring1][=Branch2][F][C][=N][C][Branch1][C][Cl][=C][Branch1][C][F][C][=C][Ring1][Branch2][C][Ring2][Ring1][=Branch1][=O]"
],
"smiles": [
"CCOC(=O)c1cn(-c2cc(N)c(F)c(F)c2F)c2nc(Cl)c(F)cc2c1=O"
]
}
|
CCOC(=O)c1cn(-c2cc([N+](=O)[O-])c(F)c(F)c2F)c2nc(Cl)c(F)cc2c1=O
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>",
"role": "user"
},
{
"content": "CCOC(=O)c1cn(-c2cc([N+](=O)[O-])c(F)c(F)c2F)c2nc(Cl)c(F)cc2c1=O",
"role": "assistant"
}
] |
291
|
{
"selfies": [
"[C][O][C][=C][C][Branch1][C][N][=C][Branch1][C][Cl][C][=C][Ring1][Branch2][C][=Branch1][C][=O][N][C][C][C][C][N][Branch2][Ring1][C][C][C][C][C][N][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][Ring2][Ring1][Ring1]"
],
"smiles": [
"COc1cc(N)c(Cl)cc1C(=O)NCC1CCN(CCCCNC(=O)c2ccccc2)CC1"
]
}
|
COc1cc(N)c(Cl)cc1C(=O)NCC1CCN(CCCCN)CC1.O=C(O)c1ccccc1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .",
"role": "user"
},
{
"content": "The potential reactants: COc1cc(N)c(Cl)cc1C(=O)NCC1CCN(CCCCN)CC1.O=C(O)c1ccccc1 .",
"role": "assistant"
}
] |
292
|
{
"selfies": [
"[C][C][C][C][C][=N][N][Branch1][O][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][N][Ring1][=C][C][C][=C][C][=C][Branch2][Ring1][Ring1][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=N][O][C][=Branch1][C][=O][NH1][Ring1][=Branch1][C][=C][Ring2][Ring1][C]"
],
"smiles": [
"CCCCc1nn(CCc2ccccc2)c(=O)n1Cc1ccc(-c2ccccc2-c2noc(=O)[nH]2)cc1"
]
}
|
CCCCc1nn(CCc2ccccc2)c(=O)n1Cc1ccc(-c2ccccc2C#N)cc1.O=C([O-])O.[NH3+]O
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>",
"role": "user"
},
{
"content": "CCCCc1nn(CCc2ccccc2)c(=O)n1Cc1ccc(-c2ccccc2C#N)cc1.O=C([O-])O.[NH3+]O",
"role": "assistant"
}
] |
293
|
{
"selfies": [
"[O][=C][Branch1][C][O][C][=C][Branch2][Ring1][=C][N][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][C][C][C][N][C][C][C][C][Ring1][Branch1][C][=C][C][=C][Ring2][Ring1][=Branch2][O][C][C][O][C][C][C][Ring1][=Branch2][Ring1][Branch1]"
],
"smiles": [
"O=C(O)c1c(NS(=O)(=O)c2ccc(F)cc2CCCN2CCCC2)ccc2c1OCC1OCCC21"
]
}
|
COC(=O)c1c(NS(=O)(=O)c2ccc(F)cc2CCCN2CCCC2)ccc2c1OCC1OCCC21
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Do retrosynthesis with the product <molecule_2d> .",
"role": "user"
},
{
"content": "OK. The reactants may be COC(=O)c1c(NS(=O)(=O)c2ccc(F)cc2CCCN2CCCC2)ccc2c1OCC1OCCC21 .",
"role": "assistant"
}
] |
294
|
{
"selfies": [
"[C][C][Branch1][C][C][C][Branch1][C][O][Branch2][Ring1][=Branch1][C][=C][C][=C][C][Branch1][N][C][=C][C][=C][C][Branch1][C][F][=C][Ring1][#Branch1][=C][Ring1][=N][C][=C][NH1][C][=N][Ring1][Branch1]"
],
"smiles": [
"CC(C)C(O)(c1cccc(-c2cccc(F)c2)c1)c1c[nH]cn1"
]
}
|
CC(C)C(O)(c1cccc(-c2cccc(F)c2)c1)c1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>",
"role": "user"
},
{
"content": "CC(C)C(O)(c1cccc(-c2cccc(F)c2)c1)c1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1",
"role": "assistant"
}
] |
295
|
{
"selfies": [
"[O][=C][Branch1][C][O][C][O][C][=C][C][=C][C][=C][Branch2][Ring1][#Branch2][C][O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Ring1][=Branch2][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][Ring2][Ring1][#Branch1][=C][Ring2][Ring1][O]"
],
"smiles": [
"O=C(O)COc1ccc2cc(-c3oc4ccccc4c3C(=O)c3ccccc3)ccc2c1"
]
}
|
COC(=O)COc1ccc2cc(-c3oc4ccccc4c3C(=O)c3ccccc3)ccc2c1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Do retrosynthesis with the product <molecule_2d> .",
"role": "user"
},
{
"content": "OK. The reactants may be COC(=O)COc1ccc2cc(-c3oc4ccccc4c3C(=O)c3ccccc3)ccc2c1 .",
"role": "assistant"
}
] |
296
|
{
"selfies": [
"[C][O][C][=N][C][=C][C][Branch1][C][Cl][=C][Branch1][C][Cl][C][Branch1][O][C][=N][N][=N][N][Ring1][Branch1][C][C][O][=C][Ring1][S][N][=C][Ring2][Ring1][Ring2][O][C]"
],
"smiles": [
"COc1nc2cc(Cl)c(Cl)c(-c3nnnn3CCO)c2nc1OC"
]
}
|
COC(=O)Cn1nnnc1-c1c(Cl)c(Cl)cc2nc(OC)c(OC)nc12
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.",
"role": "user"
},
{
"content": "COC(=O)Cn1nnnc1-c1c(Cl)c(Cl)cc2nc(OC)c(OC)nc12",
"role": "assistant"
}
] |
297
|
{
"selfies": [
"[C][C][=N][N][=C][Branch1][Ring1][C][N][C][=Branch1][C][=O][NH1][Ring1][=Branch2]"
],
"smiles": [
"Cc1nnc(CN)c(=O)[nH]1"
]
}
|
Cc1nnc(CN2C(=O)c3ccccc3C2=O)c(=O)[nH]1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "What reactants could lead to the production of the following product? <molecule_2d>",
"role": "user"
},
{
"content": "Cc1nnc(CN2C(=O)c3ccccc3C2=O)c(=O)[nH]1",
"role": "assistant"
}
] |
298
|
{
"selfies": [
"[O][=C][C][=C][C][Branch1][C][Cl][=C][C][=C][Ring1][#Branch1][O][C][=C][N][Ring1][N][C][C][N][C][C][N][Branch1][=Branch2][C][=N][C][=C][C][=N][Ring1][=Branch1][C][C][Ring1][N]"
],
"smiles": [
"O=C1c2cc(Cl)ccc2OC=CN1CCN1CCN(c2ncccn2)CC1"
]
}
|
O=C1c2cc(Cl)ccc2OC=CN1CCCl.c1cnc(N2CCNCC2)nc1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.",
"role": "user"
},
{
"content": "Here are possible reactants: O=C1c2cc(Cl)ccc2OC=CN1CCCl.c1cnc(N2CCNCC2)nc1 .",
"role": "assistant"
}
] |
299
|
{
"selfies": [
"[C][C][=C][Branch1][=Branch2][N][C][C][C][C][C][Ring1][Branch1][N][N][=C][Branch2][Ring1][Ring1][C][=C][C][=N][C][Branch1][=Branch2][N][C][C][C][C][C][Ring1][Branch1][=N][Ring1][N][C][Branch2][Ring1][Ring1][C][=C][C][=N][C][Branch1][=Branch2][N][C][C][C][C][C][Ring1][Branch1][=N][Ring1][N][=C][Ring2][Ring1][=N][C][=Ring2][Ring2][#Branch1]"
],
"smiles": [
"c1cc(NC2CCCC2)n2nc(-c3ccnc(NC4CCCC4)n3)c(-c3ccnc(NC4CCCC4)n3)c2c1"
]
}
|
Clc1cccc2c(-c3ccnc(NC4CCCC4)n3)c(-c3ccnc(NC4CCCC4)n3)nn12.NC1CCCC1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?",
"role": "user"
},
{
"content": "Clc1cccc2c(-c3ccnc(NC4CCCC4)n3)c(-c3ccnc(NC4CCCC4)n3)nn12.NC1CCCC1",
"role": "assistant"
}
] |
300
|
{
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][N][C][=Branch1][C][=O][C][Branch1][=Branch2][C][C][=C][C][=C][S][Ring1][Branch1][N][C][=Branch1][C][=O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"CC(C)(C)NC(=O)C(Cc1cccs1)NC(=O)OCc1ccccc1"
]
}
|
CC(C)(C)N.O=C(NC(Cc1cccs1)C(=O)O)OCc1ccccc1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.",
"role": "user"
},
{
"content": "Here are possible reactants: CC(C)(C)N.O=C(NC(Cc1cccs1)C(=O)O)OCc1ccccc1 .",
"role": "assistant"
}
] |
301
|
{
"selfies": [
"[C][S][=Branch1][C][=O][=Branch1][C][=O][N][Branch1][O][C][C][N][C][C][O][C][C][Ring1][=Branch1][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][=Branch1][C][=O][C][=Branch1][C][=O][N][Ring1][Branch2][C][C][=Branch1][C][=O][O][C][Branch1][P][C][C][=C][Branch1][C][Cl][C][=N+1][Branch1][C][O-1][C][=C][Ring1][Branch2][Cl][C][=C][C][=C][Branch1][#Branch1][O][C][Branch1][C][F][F][C][Branch1][Branch2][O][C][C][C][C][Ring1][Ring1][=C][Ring1][#C]"
],
"smiles": [
"CS(=O)(=O)N(CCN1CCOCC1)c1ccc2c(c1)C(=O)C(=O)N2CC(=O)OC(Cc1c(Cl)c[n+]([O-])cc1Cl)c1ccc(OC(F)F)c(OCC2CC2)c1"
]
}
|
CS(=O)(=O)N(CCN1CCOCC1)c1ccc2c(c1)C(=O)C(=O)N2CC(=O)O.[O-][n+]1cc(Cl)c(CC(O)c2ccc(OC(F)F)c(OCC3CC3)c2)c(Cl)c1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "What reactants could lead to the production of the following product? <molecule_2d>",
"role": "user"
},
{
"content": "CS(=O)(=O)N(CCN1CCOCC1)c1ccc2c(c1)C(=O)C(=O)N2CC(=O)O.[O-][n+]1cc(Cl)c(CC(O)c2ccc(OC(F)F)c(OCC3CC3)c2)c(Cl)c1",
"role": "assistant"
}
] |
302
|
{
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][N][Branch2][Ring1][O][C][=C][C][=C][Branch1][#Branch2][S][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][=C][Ring1][S][C][C][Ring2][Ring1][=Branch1]"
],
"smiles": [
"CC(C)(C)OC(=O)N1CCN(c2ccc(Sc3ccccc3)c([N+](=O)[O-])c2)CC1"
]
}
|
CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.O=[N+]([O-])c1cc(N2CCNCC2)ccc1Sc1ccccc1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?",
"role": "user"
},
{
"content": "CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.O=[N+]([O-])c1cc(N2CCNCC2)ccc1Sc1ccccc1",
"role": "assistant"
}
] |
303
|
{
"selfies": [
"[C][C][=C][C][=C][Branch2][Ring2][#Branch2][S][=Branch1][C][=O][=Branch1][C][=O][N][C][C][C][Branch2][Ring1][#Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][Ring1][#Branch2][C][C][Ring2][Ring1][Ring2][C][=C][Ring2][Ring1][=N]"
],
"smiles": [
"Cc1ccc(S(=O)(=O)N2CCC(c3cccc4c3CCCC(C(=O)O)=C4)CC2)cc1"
]
}
|
COC(=O)C1=Cc2cccc(C3CCN(S(=O)(=O)c4ccc(C)cc4)CC3)c2CCC1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.",
"role": "user"
},
{
"content": "COC(=O)C1=Cc2cccc(C3CCN(S(=O)(=O)c4ccc(C)cc4)CC3)c2CCC1",
"role": "assistant"
}
] |
304
|
{
"selfies": [
"[C][N][C][=C][Branch2][Ring1][=C][C][=C][N][=C][C][=C][Branch1][C][F][C][Branch1][Branch2][C][C][=Branch1][C][=O][N][N][=C][Branch1][C][F][C][Ring1][=N][=C][Ring1][P][C][=N][Ring2][Ring1][=Branch1]"
],
"smiles": [
"Cn1cc(-c2cnc3cc(F)c(CC(=O)NN)c(F)c3c2)cn1"
]
}
|
COC(=O)Cc1c(F)cc2ncc(-c3cnn(C)c3)cc2c1F.NN
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>",
"role": "user"
},
{
"content": "COC(=O)Cc1c(F)cc2ncc(-c3cnn(C)c3)cc2c1F.NN",
"role": "assistant"
}
] |
305
|
{
"selfies": [
"[O][=C][NH1][C][=C][C][=C][Branch1][C][Br][C][=C][Ring1][#Branch1][C][=Branch1][C][=O][O][Ring1][N]"
],
"smiles": [
"O=c1[nH]c2ccc(Br)cc2c(=O)o1"
]
}
|
BrBr.O=c1[nH]c2ccccc2c(=O)o1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>",
"role": "user"
},
{
"content": "BrBr.O=c1[nH]c2ccccc2c(=O)o1",
"role": "assistant"
}
] |
306
|
{
"selfies": [
"[Cl][C][=C][C][Branch1][Branch2][N][C][C][C][C][Ring1][Branch1][=C][C][Branch1][C][Cl][=N][Ring1][N]"
],
"smiles": [
"Clc1cc(N2CCCC2)cc(Cl)n1"
]
}
|
C1CCNC1.Clc1cc(Cl)nc(Cl)c1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?",
"role": "user"
},
{
"content": "C1CCNC1.Clc1cc(Cl)nc(Cl)c1",
"role": "assistant"
}
] |
307
|
{
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][C][=C][C][=C][Branch2][Ring2][#Branch2][C][C][=Branch1][C][=O][N][C][Branch1][#C][C][=C][C][=C][Branch1][C][F][C][Branch1][C][F][=C][Ring1][Branch2][C][=C][N][Branch1][#Branch2][C][Si][Branch1][C][C][Branch1][C][C][C][N][=N][Ring1][#Branch2][C][=C][Ring2][Ring1][=N]"
],
"smiles": [
"CC(C)(C)c1ccc(CC(=O)NC(c2ccc(F)c(F)c2)c2cn(C[Si](C)(C)C)nn2)cc1"
]
}
|
CC(C)(C)c1ccc(CC(=O)O)cc1.C[Si](C)(C)Cn1cc(C([NH3+])c2ccc(F)c(F)c2)nn1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "What reactants could lead to the production of the following product? <molecule_2d>",
"role": "user"
},
{
"content": "CC(C)(C)c1ccc(CC(=O)O)cc1.C[Si](C)(C)Cn1cc(C([NH3+])c2ccc(F)c(F)c2)nn1",
"role": "assistant"
}
] |
308
|
{
"selfies": [
"[O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Branch1][C][O][C][C][C][N][Branch1][#Branch2][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][Ring1][#C]"
],
"smiles": [
"OCc1ccccc1C1(O)CCCN(Cc2ccccc2)CC1"
]
}
|
O=C1CCCN(Cc2ccccc2)CC1.OCc1ccccc1Br
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>",
"role": "user"
},
{
"content": "O=C1CCCN(Cc2ccccc2)CC1.OCc1ccccc1Br",
"role": "assistant"
}
] |
309
|
{
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][Branch2][Ring1][#C][C][=Branch1][C][=O][N][C][C][=Branch1][C][=O][N][C][Ring1][Branch1][S][C][Branch1][C][C][Branch1][C][C][C][Ring1][#Branch1][C][=Branch1][C][=O][O][=C][S][C][C][S][Ring1][Branch1]"
],
"smiles": [
"CCOC(=O)C(C(=O)NC1C(=O)N2C1SC(C)(C)C2C(=O)O)=C1SCCS1"
]
}
|
CCOC(=O)C(C(=O)NC1C(=O)N2C1SC(C)(C)C2C(=O)[O-])=C1SCCS1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>",
"role": "user"
},
{
"content": "CCOC(=O)C(C(=O)NC1C(=O)N2C1SC(C)(C)C2C(=O)[O-])=C1SCCS1",
"role": "assistant"
}
] |
310
|
{
"selfies": [
"[O][=C][Branch1][S][N][C][=C][C][=C][C][=C][C][=C][C][Ring1][=Branch1][=N][Ring1][#Branch2][N][C][C][N][Branch2][Ring1][C][C][=N][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][=N][S][Ring1][O][C][C][Ring1][P]"
],
"smiles": [
"O=C(Nc1ccc2ccccc2n1)N1CCN(c2nc(-c3ccccc3)ns2)CC1"
]
}
|
O=C(Nc1ccc2ccccc2n1)OCC(Cl)(Cl)Cl.c1ccc(-c2nsc(N3CCNCC3)n2)cc1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.",
"role": "user"
},
{
"content": "O=C(Nc1ccc2ccccc2n1)OCC(Cl)(Cl)Cl.c1ccc(-c2nsc(N3CCNCC3)n2)cc1",
"role": "assistant"
}
] |
311
|
{
"selfies": [
"[C][C][C][N][Branch1][Ring2][C][C][C][C][=Branch1][C][=O][C][C][C][Branch1][N][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][=N][N][C][=C][C][=N][C][=Ring1][S][Ring1][=Branch1]"
],
"smiles": [
"CCCN(CCC)C(=O)Cc1c(-c2ccc(Cl)cc2)nn2cccnc12"
]
}
|
CCCNCCC.O=C(O)Cc1c(-c2ccc(Cl)cc2)nn2cccnc12
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>",
"role": "user"
},
{
"content": "CCCNCCC.O=C(O)Cc1c(-c2ccc(Cl)cc2)nn2cccnc12",
"role": "assistant"
}
] |
312
|
{
"selfies": [
"[C][N][C][=C][C][=C][Branch2][Ring1][S][N][=C][N][Ring1][Branch1][C][=C][C][=C][Branch1][C][F][C][Branch1][=C][C][=C][C][Branch1][C][F][=C][C][=C][Ring1][#Branch1][C][#N][=C][Ring1][S][C][Ring2][Ring1][=Branch2][=O]"
],
"smiles": [
"Cn1ccc2c(ncn2-c2ccc(F)c(-c3cc(F)ccc3C#N)c2)c1=O"
]
}
|
CC1(C)OB(c2cc(F)ccc2C#N)OC1(C)C.Cn1ccc2c(ncn2-c2ccc(F)c(Br)c2)c1=O
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Given the following product, please provide possible reactants. <molecule_2d>",
"role": "user"
},
{
"content": "Possible reactant(s): CC1(C)OB(c2cc(F)ccc2C#N)OC1(C)C.Cn1ccc2c(ncn2-c2ccc(F)c(Br)c2)c1=O .",
"role": "assistant"
}
] |
313
|
{
"selfies": [
"[C][N][C][=C][Branch2][Ring2][Branch2][C][=C][C][=C][Branch2][Ring1][=Branch2][N][C][=C][C][Branch1][=C][O][C][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][=C][C][Ring1][#C][=O][C][=C][Ring2][Ring1][=Branch1][Ring2][Ring1][=Branch2][C][C][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][C][Ring2][Ring2][Ring2]"
],
"smiles": [
"Cn1c2c(c3ccc(-n4ccc(OCc5ccc(F)cc5)cc4=O)cc31)CCN(C(=O)OC(C)(C)C)CC2"
]
}
|
Cn1c2c(c3ccc(Br)cc31)CCN(C(=O)OC(C)(C)C)CC2.O=c1cc(OCc2ccc(F)cc2)cc[nH]1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>",
"role": "user"
},
{
"content": "Cn1c2c(c3ccc(Br)cc31)CCN(C(=O)OC(C)(C)C)CC2.O=c1cc(OCc2ccc(F)cc2)cc[nH]1",
"role": "assistant"
}
] |
314
|
{
"selfies": [
"[C][O][C][=Branch1][C][=O][C][=C][Branch1][C][C][N][C][Branch1][C][C][=C][Branch2][Ring1][N][C][=Branch1][C][=O][O][C][C][C][C][C][C][N][C][C][Branch1][C][O][C][O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring2][Ring1][=N][C][=C][C][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][#Branch2]"
],
"smiles": [
"COC(=O)C1=C(C)NC(C)=C(C(=O)OCCCCCCNCC(O)COc2ccccc2)C1c1cccc(C(F)(F)F)c1"
]
}
|
COC(=O)C1=C(C)NC(C)=C(C(=O)OCCCCCCN)C1c1cccc(C(F)(F)F)c1.c1ccc(OCC2CO2)cc1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.",
"role": "user"
},
{
"content": "Here are possible reactants: COC(=O)C1=C(C)NC(C)=C(C(=O)OCCCCCCN)C1c1cccc(C(F)(F)F)c1.c1ccc(OCC2CO2)cc1 .",
"role": "assistant"
}
] |
315
|
{
"selfies": [
"[C][#C][C][N][C][=N][C][=Branch1][C][=O][S][C][Ring1][=Branch1][=C][C][C][C][N][Branch1][S][C][C][=C][C][=C][C][=C][C][=C][C][Ring1][=Branch1][=C][Ring1][#Branch2][C][C][Ring1][P]"
],
"smiles": [
"C#CCNC1=NC(=O)SC1=CC1CCN(Cc2ccc3ccccc3c2)CC1"
]
}
|
C#CCNC1=NC(=O)SC1=CC1CCNCC1.O=Cc1ccc2ccccc2c1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.",
"role": "user"
},
{
"content": "C#CCNC1=NC(=O)SC1=CC1CCNCC1.O=Cc1ccc2ccccc2c1",
"role": "assistant"
}
] |
316
|
{
"selfies": [
"[O][=S][=Branch1][C][=O][Branch2][Ring1][Ring1][N][C][C][C][O][C][=C][C][=C][C][=N][C][=C][N][Ring1][=Branch2][Ring1][Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"O=S(=O)(NCCCOc1cccc2nccn12)c1ccccc1"
]
}
|
NCCCOc1cccc2nccn12.O=S(=O)(Cl)c1ccccc1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.",
"role": "user"
},
{
"content": "NCCCOc1cccc2nccn12.O=S(=O)(Cl)c1ccccc1",
"role": "assistant"
}
] |
317
|
{
"selfies": [
"[C][S][=Branch1][C][=O][=Branch1][C][=O][N][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][Branch1][#Branch1][C][C][=Branch1][C][=O][O][N][Ring1][=N]"
],
"smiles": [
"CS(=O)(=O)Nc1ccc2c(c1)S(=O)(=O)C=C(CC(=O)O)N2"
]
}
|
CCOC(=O)CC1=CS(=O)(=O)c2cc(NS(C)(=O)=O)ccc2N1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "What reactants could lead to the production of the following product? <molecule_2d>",
"role": "user"
},
{
"content": "CCOC(=O)CC1=CS(=O)(=O)c2cc(NS(C)(=O)=O)ccc2N1",
"role": "assistant"
}
] |
318
|
{
"selfies": [
"[C][N][C][C][C][Branch2][Ring2][=C][N][C][C][=C][C][Branch1][C][Cl][=C][C][=C][Ring1][#Branch1][N][C][=Branch2][Ring1][Branch2][=N][N][=C][Ring1][Branch1][C][C][C][N][Branch1][=Branch2][C][=C][C][=C][C][=N][Ring1][=Branch1][C][C][Ring1][N][C][Ring2][Ring1][O][C][Ring2][Ring1][S]"
],
"smiles": [
"CN1CCC(N2Cc3cc(Cl)ccc3-n3c(nnc3C3CCN(c4ccccn4)CC3)C2)C1"
]
}
|
C=O.Clc1ccc2c(c1)CN(C1CCNC1)Cc1nnc(C3CCN(c4ccccn4)CC3)n1-2
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?",
"role": "user"
},
{
"content": "C=O.Clc1ccc2c(c1)CN(C1CCNC1)Cc1nnc(C3CCN(c4ccccn4)CC3)n1-2",
"role": "assistant"
}
] |
319
|
{
"selfies": [
"[C][=C][C][=C][Branch2][Ring2][Ring1][N][C][C][N][Branch2][Ring1][#Branch1][C][=C][C][=C][Branch1][Branch1][N][=N][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][Ring1][N][C][C][Ring2][Ring1][Ring2][N][=C][Ring2][Ring1][#Branch2]"
],
"smiles": [
"c1ccc(N2CCN(c3cc4c(nn3)-c3ccccc3CC4)CC2)nc1"
]
}
|
Clc1cc2c(nn1)-c1ccccc1CC2.c1ccc(N2CCNCC2)nc1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?",
"role": "user"
},
{
"content": "Clc1cc2c(nn1)-c1ccccc1CC2.c1ccc(N2CCNCC2)nc1",
"role": "assistant"
}
] |
320
|
{
"selfies": [
"[C][=C][C][=C][Branch1][P][C][C][O][C][=C][C][=C][NH1][C][=C][C][Ring1][Branch1][=C][Ring1][=Branch2][C][=C][Ring2][Ring1][C]"
],
"smiles": [
"c1ccc(CCOc2ccc3[nH]ccc3c2)cc1"
]
}
|
BrCCc1ccccc1.Oc1ccc2[nH]ccc2c1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.",
"role": "user"
},
{
"content": "Here are possible reactants: BrCCc1ccccc1.Oc1ccc2[nH]ccc2c1 .",
"role": "assistant"
}
] |
321
|
{
"selfies": [
"[C][C][=C][C][Branch1][=Branch1][N][Branch1][C][C][C][=N][C][Branch2][Ring1][=Branch2][N][C][C][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][C][Ring1][N][O][=N][Ring2][Ring1][#Branch1]"
],
"smiles": [
"Cc1cc(N(C)C)nc(NC2CN(C(=O)OC(C)(C)C)CC2O)n1"
]
}
|
CC(C)(C)OC(=O)N1CC(N)C(O)C1.Cc1cc(N(C)C)nc(Cl)n1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.",
"role": "user"
},
{
"content": "CC(C)(C)OC(=O)N1CC(N)C(O)C1.Cc1cc(N(C)C)nc(Cl)n1",
"role": "assistant"
}
] |
322
|
{
"selfies": [
"[C][C][N][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][Branch2][Ring1][Ring1][C][N][C][C][C][C][Branch1][Branch2][C][=C][N][=N][NH1][Ring1][Branch1][C][Ring1][O][=C][C][=C][Ring2][Ring1][C][Ring2][Ring1][=Branch2]"
],
"smiles": [
"CCn1c2ccccc2c2cc(CN3CCCC(c4cnn[nH]4)C3)ccc21"
]
}
|
CCn1c2ccccc2c2cc(C=O)ccc21.c1nn[nH]c1C1CCCNC1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .",
"role": "user"
},
{
"content": "The potential reactants: CCn1c2ccccc2c2cc(C=O)ccc21.c1nn[nH]c1C1CCCNC1 .",
"role": "assistant"
}
] |
323
|
{
"selfies": [
"[O][=C][NH1][C][Branch1][O][C][=C][C][=C][Branch1][C][Br][S][Ring1][=Branch1][=N][N][Ring1][O][C][=C][C][Branch1][C][Cl][=C][Branch1][C][Br][C][=C][Ring1][Branch2][O]"
],
"smiles": [
"O=c1[nH]c(-c2ccc(Br)s2)nn1-c1cc(Cl)c(Br)cc1O"
]
}
|
COc1cc(Br)c(Cl)cc1-n1nc(-c2ccc(Br)s2)[nH]c1=O
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.",
"role": "user"
},
{
"content": "Here are possible reactants: COc1cc(Br)c(Cl)cc1-n1nc(-c2ccc(Br)s2)[nH]c1=O .",
"role": "assistant"
}
] |
324
|
{
"selfies": [
"[O][=C][Branch1][C][O][C][=N][N][Branch1][=N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][F][C][=C][Ring1][=N][C][C][C][Ring1][Ring1][C][Ring1][=Branch1]"
],
"smiles": [
"O=C(O)c1nn(-c2ccc(F)cc2F)c2c1C1CC1C2"
]
}
|
CCOC(=O)c1nn(-c2ccc(F)cc2F)c2c1C1CC1C2
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.",
"role": "user"
},
{
"content": "CCOC(=O)c1nn(-c2ccc(F)cc2F)c2c1C1CC1C2",
"role": "assistant"
}
] |
325
|
{
"selfies": [
"[O][=C][Branch1][Ring1][N][O][C][Branch1][N][C][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][=N][C][Branch1][C][O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring1][=C]"
],
"smiles": [
"O=C(NO)C(CCCc1ccccc1)CS(=O)(=O)c1ccc(C(O)c2ccccc2)cc1"
]
}
|
O=C(c1ccccc1)c1ccc(S(=O)(=O)CC(CCCc2ccccc2)C(=O)NO)cc1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "What reactants could lead to the production of the following product? <molecule_2d>",
"role": "user"
},
{
"content": "O=C(c1ccccc1)c1ccc(S(=O)(=O)CC(CCCc2ccccc2)C(=O)NO)cc1",
"role": "assistant"
}
] |
326
|
{
"selfies": [
"[C][N][C][C][C][Branch2][Ring2][N][N][C][=C][Branch2][Ring1][P][C][=C][N][=C][Branch2][Ring1][Branch1][C][=C][C][=C][C][Branch1][O][C][C][=N][N][Branch1][C][C][C][=Ring1][=Branch1][=C][Ring1][N][N][=C][Ring2][Ring1][C][C][=N][Ring2][Ring1][#Branch1][C][C][Ring2][Ring1][=N]"
],
"smiles": [
"CN1CCC(n2cc(-c3cnc(-c4cccc(-c5cnn(C)c5)c4)nc3)cn2)CC1"
]
}
|
C=O.Cn1cc(-c2cccc(-c3ncc(-c4cnn(C5CCNCC5)c4)cn3)c2)cn1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>",
"role": "user"
},
{
"content": "C=O.Cn1cc(-c2cccc(-c3ncc(-c4cnn(C5CCNCC5)c4)cn3)c2)cn1",
"role": "assistant"
}
] |
327
|
{
"selfies": [
"[O][=S][=Branch1][C][=O][Branch1][S][C][=C][C][Branch1][C][Br][=C][Branch1][C][Cl][C][=C][Ring1][Branch2][O][N][C][C][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring1][O]"
],
"smiles": [
"O=S(=O)(c1cc(Br)c(Cl)cc1O)N1CCCCc2ccccc21"
]
}
|
COc1cc(Cl)c(Br)cc1S(=O)(=O)N1CCCCc2ccccc21
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .",
"role": "user"
},
{
"content": "The potential reactants: COc1cc(Cl)c(Br)cc1S(=O)(=O)N1CCCCc2ccccc21 .",
"role": "assistant"
}
] |
328
|
{
"selfies": [
"[C][N][C][=Branch1][C][=O][N][Branch1][=N][C][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][C][=Branch1][C][=O][C][=C][C][Branch2][Ring1][Branch1][C][=Branch1][C][=O][C][=N][C][Branch1][C][Br][=C][C][=C][C][=C][N][Ring1][#Branch2][Ring1][=Branch1][=C][C][=C][Ring2][Ring1][C][Ring2][Ring1][S]"
],
"smiles": [
"Cn1c(=O)n(Cc2ccc(F)cc2)c(=O)c2cc(C(=O)c3nc(Br)c4ccccn34)ccc21"
]
}
|
CI.O=C(c1ccc2[nH]c(=O)n(Cc3ccc(F)cc3)c(=O)c2c1)c1nc(Br)c2ccccn12
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.",
"role": "user"
},
{
"content": "Here are possible reactants: CI.O=C(c1ccc2[nH]c(=O)n(Cc3ccc(F)cc3)c(=O)c2c1)c1nc(Br)c2ccccn12 .",
"role": "assistant"
}
] |
329
|
{
"selfies": [
"[C][C][Branch1][C][C][O][B][Branch2][Ring1][#Branch2][C][=C][C][=C][Branch1][S][C][=N][N][=C][N][Ring1][Branch1][C][C][C][C][C][O][Ring1][=Branch1][C][=C][Ring1][P][O][C][Ring2][Ring1][#Branch1][Branch1][C][C][C]"
],
"smiles": [
"CC1(C)OB(c2ccc(-c3nncn3C3CCCCO3)cc2)OC1(C)C"
]
}
|
Brc1ccc(-c2nncn2C2CCCCO2)cc1.CC1(C)OB(B2OC(C)(C)C(C)(C)O2)OC1(C)C
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.",
"role": "user"
},
{
"content": "Here are possible reactants: Brc1ccc(-c2nncn2C2CCCCO2)cc1.CC1(C)OB(B2OC(C)(C)C(C)(C)O2)OC1(C)C .",
"role": "assistant"
}
] |
330
|
{
"selfies": [
"[C][C][C][C][C][=N][C][=N][C][Branch2][Ring2][#C][N][C][C][N][Branch2][Ring2][C][C][=Branch1][C][=O][C][Branch1][=N][C][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][N][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][C][Ring2][Ring1][=Branch2][C][=C][Ring2][Ring1][S][Ring2][Ring2][Ring1]"
],
"smiles": [
"CC1CCc2ncnc(N3CCN(C(=O)C(Cc4ccc(Cl)cc4)NC(=O)OC(C)(C)C)CC3C)c21"
]
}
|
CC(C)(C)OC(=O)NC(Cc1ccc(Cl)cc1)C(=O)O.CC1CCc2ncnc(N3CCNCC3C)c21
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?",
"role": "user"
},
{
"content": "CC(C)(C)OC(=O)NC(Cc1ccc(Cl)cc1)C(=O)O.CC1CCc2ncnc(N3CCNCC3C)c21",
"role": "assistant"
}
] |
331
|
{
"selfies": [
"[O][=C][Branch2][Branch1][=Branch1][N][C][=C][C][=C][C][Branch2][Ring2][=Branch2][C][=C][N][Branch2][Ring1][=C][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=N][Ring2][Ring1][Branch2][=C][Ring2][Ring1][=C][C][=C][C][=C][C][=C][N][Branch1][#Branch1][C][Ring1][Branch1][=N][Ring1][=Branch2][C][C][C][N][C][Ring1][=Branch2][=O]"
],
"smiles": [
"O=C(Nc1cccc(-c2cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cn2)c1)c1ccc2cc3n(c2n1)CCCNC3=O"
]
}
|
Nc1cccc(-c2cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cn2)c1.O=C(O)c1ccc2cc3n(c2n1)CCCNC3=O
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.",
"role": "user"
},
{
"content": "Nc1cccc(-c2cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cn2)c1.O=C(O)c1ccc2cc3n(c2n1)CCCNC3=O",
"role": "assistant"
}
] |
332
|
{
"selfies": [
"[C][C][N][C][=C][Branch2][Ring2][Ring1][C][=C][N][=C][Branch1][C][N][C][Branch2][Ring1][Ring2][C][=C][C][=C][Branch1][#Branch1][C][=Branch1][C][=O][O][C][C][Branch1][C][F][=C][Ring1][O][=N][Ring2][Ring1][C][C][=N][Ring2][Ring1][#Branch1]"
],
"smiles": [
"CCn1cc(-c2cnc(N)c(-c3ccc(C(=O)OC)c(F)c3)n2)cn1"
]
}
|
CCBr.COC(=O)c1ccc(-c2nc(-c3cn[nH]c3)cnc2N)cc1F
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "What reactants could lead to the production of the following product? <molecule_2d>",
"role": "user"
},
{
"content": "CCBr.COC(=O)c1ccc(-c2nc(-c3cn[nH]c3)cnc2N)cc1F",
"role": "assistant"
}
] |
333
|
{
"selfies": [
"[C][O][C][=C][C][=C][Branch2][Ring1][Branch1][C][=Branch1][C][=O][C][=C][C][=C][C][Branch1][#Branch1][O][C][Branch1][C][C][C][=C][Ring1][#Branch2][N][=C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][Ring2][Ring1][Branch1][C][=C][Ring2][Ring1][=Branch2][O][C][C][N][C][C][C][C][Ring1][Branch1]"
],
"smiles": [
"COc1cc2c(C(=O)c3cccc(OC(C)C)c3)ncc(C(=O)O)c2cc1OCCN1CCCC1"
]
}
|
CCOC(=O)c1cnc(C(=O)c2cccc(OC(C)C)c2)c2cc(OC)c(OCCN3CCCC3)cc12
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .",
"role": "user"
},
{
"content": "The potential reactants: CCOC(=O)c1cnc(C(=O)c2cccc(OC(C)C)c2)c2cc(OC)c(OCCN3CCCC3)cc12 .",
"role": "assistant"
}
] |
334
|
{
"selfies": [
"[C][O][C][=Branch1][C][=O][C][=C][C][Branch1][C][I][=C][Branch2][Ring2][Branch1][C][C][=Branch1][C][=O][N][C][C][N][Branch2][Ring1][Ring2][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][Ring2][Ring1][Ring1][C][=C][Ring2][Ring1][=N][F]"
],
"smiles": [
"COC(=O)c1cc(I)c(CC(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1F"
]
}
|
COC(=O)c1cc(I)c(CC(=O)O)cc1F.c1ccc(C(c2ccccc2)N2CCNCC2)cc1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .",
"role": "user"
},
{
"content": "The potential reactants: COC(=O)c1cc(I)c(CC(=O)O)cc1F.c1ccc(C(c2ccccc2)N2CCNCC2)cc1 .",
"role": "assistant"
}
] |
335
|
{
"selfies": [
"[C][C][C][=C][C][=N][C][Branch2][Ring1][=C][C][=C][C][=C][Branch2][Ring1][C][C][=C][C][=C][C][=C][Branch1][C][N][C][=C][Ring1][#Branch1][O][C][C][F][C][=C][Ring2][Ring1][Ring1][=C][N][Ring2][Ring1][Branch2][C][=Ring2][Ring1][N]"
],
"smiles": [
"Cc1ccc2nc(-c3ccc(C=Cc4ccc(N)cc4OCCF)cc3)cn2c1"
]
}
|
Cc1ccc2nc(-c3ccc(C=Cc4ccc([N+](=O)[O-])cc4OCCF)cc3)cn2c1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?",
"role": "user"
},
{
"content": "Cc1ccc2nc(-c3ccc(C=Cc4ccc([N+](=O)[O-])cc4OCCF)cc3)cn2c1",
"role": "assistant"
}
] |
336
|
{
"selfies": [
"[C][O][C][=C][C][=C][C][Branch1][C][N][=C][C][Ring1][#Branch1][=N][N][Ring1][#Branch2][C][C][Branch1][C][C][Branch1][Ring1][C][#N][N][C][=Branch1][C][=O][C][=C][C][=C][Branch1][#Branch2][O][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][O]"
],
"smiles": [
"COc1c2ccc(N)cc2nn1CC(C)(C#N)NC(=O)c1ccc(OC(F)(F)F)cc1"
]
}
|
COc1c2ccc([N+](=O)[O-])cc2nn1CC(C)(C#N)NC(=O)c1ccc(OC(F)(F)F)cc1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>",
"role": "user"
},
{
"content": "COc1c2ccc([N+](=O)[O-])cc2nn1CC(C)(C#N)NC(=O)c1ccc(OC(F)(F)F)cc1",
"role": "assistant"
}
] |
337
|
{
"selfies": [
"[N][C][=C][Branch2][Ring1][Ring1][N][C][=Branch1][C][=O][C][C][C][C][C][N][Ring1][Branch1][C][C][C][Ring1][Branch2][C][=N][C][=C][C][=C][C][=C][Ring2][Ring1][=Branch1][Ring1][=Branch1]"
],
"smiles": [
"Nc1c(NC(=O)CC23CCCN2CCC3)cnc2ccccc12"
]
}
|
Nc1cnc2ccccc2c1N.O=C(Cl)CC12CCCN1CCC2
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Given the following product, please provide possible reactants. <molecule_2d>",
"role": "user"
},
{
"content": "Possible reactant(s): Nc1cnc2ccccc2c1N.O=C(Cl)CC12CCCN1CCC2 .",
"role": "assistant"
}
] |
338
|
{
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][C][Ring1][Branch1][C][=Branch1][C][=O][C][Branch1][O][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"CC(C)(C)OC(=O)N1CCCC1C(=O)C(CCc1ccccc1)CCc1ccccc1"
]
}
|
CC(C)(C)OC(=O)N1CCCC1C(O)C(CCc1ccccc1)CCc1ccccc1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "What reactants could lead to the production of the following product? <molecule_2d>",
"role": "user"
},
{
"content": "CC(C)(C)OC(=O)N1CCCC1C(O)C(CCc1ccccc1)CCc1ccccc1",
"role": "assistant"
}
] |
339
|
{
"selfies": [
"[N][#C][C][=C][C][=C][Branch2][Ring1][Ring2][O][C][C][C][N][Branch1][=Branch2][C][=C][C][=N][C][=C][Ring1][=Branch1][C][C][Ring1][N][N][=C][Ring2][Ring1][Ring1]"
],
"smiles": [
"N#Cc1ccc(OC2CCN(c3ccncc3)CC2)nc1"
]
}
|
Clc1ccncc1.N#Cc1ccc(OC2CCNCC2)nc1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.",
"role": "user"
},
{
"content": "Clc1ccncc1.N#Cc1ccc(OC2CCNCC2)nc1",
"role": "assistant"
}
] |
340
|
{
"selfies": [
"[C][O][C][=C][C][=C][Branch2][Ring1][C][N][C][=C][Branch1][C][Cl][C][=C][C][C][=C][O][C][Ring1][#Branch2][=Ring1][Branch1][N][=C][N][=C][Ring1][P][C][=C][Ring2][Ring1][Branch1][O][C][C][C][C][C][N][C][C][Ring1][=Branch1]"
],
"smiles": [
"COc1cc2c(Nc3c(Cl)ccc4ccoc34)ncnc2cc1OCCC1CCNCC1"
]
}
|
COc1cc2c(Nc3c(Cl)ccc4ccoc34)ncnc2cc1OCCC1CCN(C(=O)OC(C)(C)C)CC1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>",
"role": "user"
},
{
"content": "COc1cc2c(Nc3c(Cl)ccc4ccoc34)ncnc2cc1OCCC1CCN(C(=O)OC(C)(C)C)CC1",
"role": "assistant"
}
] |
341
|
{
"selfies": [
"[C][O][C][=N][C][=C][Branch1][P][C][N][C][=C][C][=C][Branch1][C][Br][C][Branch1][C][F][=N][Ring1][Branch2][C][=C][Ring1][S][F]"
],
"smiles": [
"COc1ncc(CNc2ccc(Br)c(F)n2)cc1F"
]
}
|
COc1ncc(CNc2cccc(F)n2)cc1F.O=C1CCC(=O)N1Br
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>",
"role": "user"
},
{
"content": "COc1ncc(CNc2cccc(F)n2)cc1F.O=C1CCC(=O)N1Br",
"role": "assistant"
}
] |
342
|
{
"selfies": [
"[C][C][=N][C][Branch1][=Branch2][C][=C][C][=C][C][=N][Ring1][=Branch1][=N][C][=C][Ring1][N][C][=Branch1][C][=O][O]"
],
"smiles": [
"Cc1nc(-c2ccccn2)ncc1C(=O)O"
]
}
|
CCOC(=O)c1cnc(-c2ccccn2)nc1C
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.",
"role": "user"
},
{
"content": "CCOC(=O)c1cnc(-c2ccccn2)nc1C",
"role": "assistant"
}
] |
343
|
{
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][N][Branch2][Ring2][C][C][=N][C][=C][Branch2][Ring1][#Branch1][C][Branch1][C][O][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][C][Branch1][C][F][Branch1][C][F][F][C][=N][Ring1][S][C][Branch2][Ring1][Branch1][C][N][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][S][Branch1][C][C][=Branch1][C][=O][=O][C][Ring2][Ring2][C]"
],
"smiles": [
"CC(C)(C)OC(=O)N1CCN(c2ncc(C(O)(C(F)(F)F)C(F)(F)F)cn2)C(CN(c2ccccc2)S(C)(=O)=O)C1"
]
}
|
CC(C)(C)OC(=O)N1CCNC(CN(c2ccccc2)S(C)(=O)=O)C1.OC(c1cnc(Cl)nc1)(C(F)(F)F)C(F)(F)F
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Do retrosynthesis with the product <molecule_2d> .",
"role": "user"
},
{
"content": "OK. The reactants may be CC(C)(C)OC(=O)N1CCNC(CN(c2ccccc2)S(C)(=O)=O)C1.OC(c1cnc(Cl)nc1)(C(F)(F)F)C(F)(F)F .",
"role": "assistant"
}
] |
344
|
{
"selfies": [
"[O][=C][Branch1][C][O][C][C][N][Branch2][Ring2][=C][C][=Branch1][C][=O][C][=C][N][C][=N][C][Branch2][Ring1][=N][C][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][=C][=N][Ring2][Ring1][Ring1][C][Ring2][Ring1][O]"
],
"smiles": [
"O=C(O)C1CN(C(=O)C=Cn2cnc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)C1"
]
}
|
COC(=O)C1CN(C(=O)C=Cn2cnc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)C1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?",
"role": "user"
},
{
"content": "COC(=O)C1CN(C(=O)C=Cn2cnc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)C1",
"role": "assistant"
}
] |
345
|
{
"selfies": [
"[C][C][=N][S][C][NH1][C][=C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][=Branch1][C][=O][C][Ring1][=N][=Ring1][#Branch2]"
],
"smiles": [
"Cc1nsc2[nH]cc(C(=O)O)c(=O)c12"
]
}
|
CCOC(=O)c1c[nH]c2snc(C)c2c1=O
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?",
"role": "user"
},
{
"content": "CCOC(=O)c1c[nH]c2snc(C)c2c1=O",
"role": "assistant"
}
] |
346
|
{
"selfies": [
"[C][C][Branch1][C][C][N][N][=C][N][=C][Ring1][Branch1][C][=C][N][C][=Branch1][Ring2][=N][Ring1][Branch1][C][=C][C][=C][Branch2][Ring1][#C][C][=C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][C][Ring1][S][C][=C][Ring2][Ring1][=Branch1][O][C][C][Ring2][Ring1][N]"
],
"smiles": [
"CC(C)n1ncnc1-c1cn2c(n1)-c1ccc(C3=C(C(=O)O)CN(C(=O)OC(C)(C)C)CC3)cc1OCC2"
]
}
|
COC(=O)C1=C(c2ccc3c(c2)OCCn2cc(-c4ncnn4C(C)C)nc2-3)CCN(C(=O)OC(C)(C)C)C1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>",
"role": "user"
},
{
"content": "COC(=O)C1=C(c2ccc3c(c2)OCCn2cc(-c4ncnn4C(C)C)nc2-3)CCN(C(=O)OC(C)(C)C)C1",
"role": "assistant"
}
] |
347
|
{
"selfies": [
"[C][C][=C][C][=C][C][Branch2][Ring2][=Branch1][C][C][N][C][C][N][Branch2][Ring1][Branch2][C][=Branch1][C][=O][C][=C][C][=C][Branch1][#Branch2][N][S][Branch1][C][C][=Branch1][C][=O][=O][C][=C][Ring1][O][C][C][Ring2][Ring1][Ring1][=N][Ring2][Ring1][O]"
],
"smiles": [
"Cc1cccc(CCN2CCN(C(=O)c3ccc(NS(C)(=O)=O)cc3)CC2)n1"
]
}
|
CS(=O)(=O)Nc1ccc(C(=O)O)cc1.Cc1cccc(CCN2CCNCC2)n1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>",
"role": "user"
},
{
"content": "CS(=O)(=O)Nc1ccc(C(=O)O)cc1.Cc1cccc(CCN2CCNCC2)n1",
"role": "assistant"
}
] |
348
|
{
"selfies": [
"[C][C][Branch1][C][C][C][C][C][Branch1][C][C][Branch1][C][C][C][=C][C][=C][Branch1][#Branch1][C][=C][Ring1][=Branch1][Ring1][=N][C][C][C][C][Ring1][Branch2][C][C][=O]"
],
"smiles": [
"CC1(C)CCC(C)(C)c2cc3c(cc21)CCCC3CC=O"
]
}
|
CC1(C)CCC(C)(C)c2cc3c(cc21)CCCC3CCO
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.",
"role": "user"
},
{
"content": "Here are possible reactants: CC1(C)CCC(C)(C)c2cc3c(cc21)CCCC3CCO .",
"role": "assistant"
}
] |
349
|
{
"selfies": [
"[C][O][C][=C][C][=C][Branch2][Ring2][S][C][N][C][C][=Branch1][C][=O][N][C][=N][C][=C][Branch2][Ring1][Branch2][C][=C][C][=Branch1][C][=O][N][C][C][Branch1][#Branch2][O][C][C][=C][C][=C][S][Ring1][Branch1][C][Ring1][O][C][=C][Ring2][Ring1][Branch1][C][Ring2][Ring1][O][C][=C][Ring2][Ring2][C]"
],
"smiles": [
"COc1ccc(CN2CC(=O)Nc3ncc(C=CC(=O)N4CC(OCc5cccs5)C4)cc3C2)cc1"
]
}
|
COc1ccc(CN2CC(=O)Nc3ncc(C=CC(=O)O)cc3C2)cc1.c1csc(COC2CNC2)c1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?",
"role": "user"
},
{
"content": "COc1ccc(CN2CC(=O)Nc3ncc(C=CC(=O)O)cc3C2)cc1.c1csc(COC2CNC2)c1",
"role": "assistant"
}
] |
350
|
{
"selfies": [
"[O][=C][Branch2][Ring1][#Branch1][C][C][C][=C][C][C][N][Branch1][#Branch2][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring1][=N][=O][N][C][=C][C][=C][C][=N][Ring1][=Branch1]"
],
"smiles": [
"O=C(CCC1=CCCN(Cc2ccccc2)C1=O)Nc1ccccn1"
]
}
|
Nc1ccccn1.O=C(O)CCC1=CCCN(Cc2ccccc2)C1=O
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?",
"role": "user"
},
{
"content": "Nc1ccccn1.O=C(O)CCC1=CCCN(Cc2ccccc2)C1=O",
"role": "assistant"
}
] |
351
|
{
"selfies": [
"[N][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][C][Ring1][Ring1][C][C][C][Ring1][Ring1]"
],
"smiles": [
"Nc1ccccc1C1CC1C1CC1"
]
}
|
O=[N+]([O-])c1ccccc1C1CC1C1CC1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?",
"role": "user"
},
{
"content": "O=[N+]([O-])c1ccccc1C1CC1C1CC1",
"role": "assistant"
}
] |
352
|
{
"selfies": [
"[C][C][C][C][=N][C][=C][Branch2][Ring1][C][C][Branch1][C][C][=C][Branch1][C][C][N][N][=N][N][=C][Ring1][O][Ring1][Branch1][N][Ring1][=C][C][C][C][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][=N][C][=Branch1][C][=O][N][C][C][O][C][C][Ring1][=Branch1][C][=C][Ring1][=C]"
],
"smiles": [
"CCCc1nc2c(c(C)c(C)n3nnnc23)n1CCCS(=O)(=O)c1ccc(C(=O)N2CCOCC2)cc1"
]
}
|
C1COCCN1.CCCc1nc2c(c(C)c(C)n3nnnc23)n1CCCS(=O)(=O)c1ccc(C(=O)O)cc1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>",
"role": "user"
},
{
"content": "C1COCCN1.CCCc1nc2c(c(C)c(C)n3nnnc23)n1CCCS(=O)(=O)c1ccc(C(=O)O)cc1",
"role": "assistant"
}
] |
353
|
{
"selfies": [
"[C][C][C][=N][C][=C][Branch1][Branch2][C][=N][N][Ring1][Branch1][C][C][C][Branch1][#Branch2][N][C][C][C][O][C][C][Ring1][=Branch1][=C][Ring2][Ring1][C][C][N][C][=Branch1][C][=O][C][=C][C][=C][C][Branch2][Ring2][N][S][=Branch1][C][=O][=Branch1][C][=O][N][C][C][=C][C][=C][C][Branch2][Ring1][#Branch1][C][=C][C][=C][C][Branch1][=N][C][C][C][C][N][Branch1][C][C][C][C][Ring1][#Branch1][=C][Ring1][=C][=C][Ring2][Ring1][Ring2][=C][Ring2][Ring1][#C]"
],
"smiles": [
"CCc1nc2c(cnn2CC)c(NC2CCOCC2)c1CNC(=O)c1cccc(S(=O)(=O)NCc2cccc(-c3cccc(CC4CCN(C)CC4)c3)c2)c1"
]
}
|
CCc1nc2c(cnn2CC)c(NC2CCOCC2)c1CN.CN1CCC(Cc2cccc(-c3cccc(CNS(=O)(=O)c4cccc(C(=O)O)c4)c3)c2)CC1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.",
"role": "user"
},
{
"content": "Here are possible reactants: CCc1nc2c(cnn2CC)c(NC2CCOCC2)c1CN.CN1CCC(Cc2cccc(-c3cccc(CNS(=O)(=O)c4cccc(C(=O)O)c4)c3)c2)CC1 .",
"role": "assistant"
}
] |
354
|
{
"selfies": [
"[O][=C][Branch1][S][C][C][C][C][Si][Branch1][C][O][C][C][C][C][C][Ring1][#Branch1][O][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][=Branch2]"
],
"smiles": [
"O=C(CCCC[Si]1(O)CCCCC1)Oc1ccc([N+](=O)[O-])cc1"
]
}
|
O=C(O)CCCC[Si]1(O)CCCCC1.O=[N+]([O-])c1ccc(O)cc1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Do retrosynthesis with the product <molecule_2d> .",
"role": "user"
},
{
"content": "OK. The reactants may be O=C(O)CCCC[Si]1(O)CCCCC1.O=[N+]([O-])c1ccc(O)cc1 .",
"role": "assistant"
}
] |
355
|
{
"selfies": [
"[O][=C][C][=C][C][=C][C][Branch2][Ring1][O][C][C][=C][C][=N][C][Branch1][N][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][=C][N][Ring1][N][C][=Ring1][S][=C][Ring2][Ring1][=Branch1][F]"
],
"smiles": [
"O=Cc1cccc(-c2ccc3nc(-c4ccc(Cl)cc4)cn3c2)c1F"
]
}
|
Clc1ccc(-c2cn3cc(Br)ccc3n2)cc1.O=Cc1cccc(B(O)O)c1F
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>",
"role": "user"
},
{
"content": "Clc1ccc(-c2cn3cc(Br)ccc3n2)cc1.O=Cc1cccc(B(O)O)c1F",
"role": "assistant"
}
] |
356
|
{
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][=N][C][Branch2][=Branch1][S][C][=Branch2][Ring1][#Branch1][=N][O][C][Branch1][C][C][Branch1][C][C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][=Branch1][C][=O][N][C][C][=Branch1][C][=O][N][C][Branch2][Ring1][=Branch2][C][=Branch1][C][=O][O][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][Branch1][Ring1][C][Cl][C][S][C][Ring2][Ring1][O][Ring2][Ring1][Branch2][=N][S][Ring2][Ring2][S]"
],
"smiles": [
"CC(C)(C)OC(=O)Nc1nc(C(=NOC(C)(C)C(=O)OC(C)(C)C)C(=O)NC2C(=O)N3C(C(=O)OC(c4ccccc4)c4ccccc4)=C(CCl)CSC23)ns1"
]
}
|
CC(C)(C)OC(=O)Nc1nc(C(=NOC(C)(C)C(=O)OC(C)(C)C)C(=O)O)ns1.NC1C(=O)N2C(C(=O)OC(c3ccccc3)c3ccccc3)=C(CCl)CSC12
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>",
"role": "user"
},
{
"content": "CC(C)(C)OC(=O)Nc1nc(C(=NOC(C)(C)C(=O)OC(C)(C)C)C(=O)O)ns1.NC1C(=O)N2C(C(=O)OC(c3ccccc3)c3ccccc3)=C(CCl)CSC12",
"role": "assistant"
}
] |
357
|
{
"selfies": [
"[C][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch2][Ring1][P][C][=Branch2][Ring1][C][=C][C][C][N][Branch1][Branch2][C][C][C][=Branch1][C][=O][O][C][Ring1][#Branch2][=O][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][=C][Ring2][Ring1][=Branch2]"
],
"smiles": [
"CS(=O)(=O)c1ccc(C(=C2CCN(CCC(=O)O)C2=O)c2ccc(Cl)cc2)cc1"
]
}
|
CCOC(=O)CCN1CCC(=C(c2ccc(Cl)cc2)c2ccc(S(C)(=O)=O)cc2)C1=O
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>",
"role": "user"
},
{
"content": "CCOC(=O)CCN1CCC(=C(c2ccc(Cl)cc2)c2ccc(S(C)(=O)=O)cc2)C1=O",
"role": "assistant"
}
] |
358
|
{
"selfies": [
"[C][C][=C][C][=C][Branch2][Branch1][Branch1][C][=C][Branch2][Ring1][Ring1][N][S][=Branch1][C][=O][=Branch1][C][=O][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][N][=C][N][=C][Ring2][Ring1][C][O][C][C][O][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][C][=N][Ring1][#Branch2][C][=C][Ring2][Ring2][=Branch1]"
],
"smiles": [
"Cc1ccc(-c2c(NS(=O)(=O)CCc3ccccc3)ncnc2OCCOc2ccc(C(F)(F)F)cn2)cc1"
]
}
|
Cc1ccc(-c2c(NS(=O)(=O)CCc3ccccc3)ncnc2OCCO)cc1.FC(F)(F)c1ccc(Cl)nc1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?",
"role": "user"
},
{
"content": "Cc1ccc(-c2c(NS(=O)(=O)CCc3ccccc3)ncnc2OCCO)cc1.FC(F)(F)c1ccc(Cl)nc1",
"role": "assistant"
}
] |
359
|
{
"selfies": [
"[C][N][C][=Branch1][C][=O][C][C][Branch1][C][N][C][S][=Branch1][C][=O][=Branch1][C][=O][C][Ring1][#Branch1]"
],
"smiles": [
"CNC(=O)CC1(N)CS(=O)(=O)C1"
]
}
|
CCOC(=O)CC1(N)CS(=O)(=O)C1.CN
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Given the following product, please provide possible reactants. <molecule_2d>",
"role": "user"
},
{
"content": "Possible reactant(s): CCOC(=O)CC1(N)CS(=O)(=O)C1.CN .",
"role": "assistant"
}
] |
360
|
{
"selfies": [
"[N][#C][N][=C][N][C][C][N][Ring1][Branch1][C][=C][C][=C][Branch1][C][N][C][=C][Ring1][#Branch1]"
],
"smiles": [
"N#CN=C1NCCN1c1ccc(N)cc1"
]
}
|
N#CN=C1NCCN1c1ccc([N+](=O)[O-])cc1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .",
"role": "user"
},
{
"content": "The potential reactants: N#CN=C1NCCN1c1ccc([N+](=O)[O-])cc1 .",
"role": "assistant"
}
] |
361
|
{
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][O][C][=C][C][Branch2][Ring1][P][C][=C][C][=C][C][Branch2][Ring1][Branch1][C][=C][C][=C][Branch1][O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring1][=C][=C][Ring2][Ring1][Ring2][=N][N][Ring2][Ring1][=Branch2][C][=C][C][=C][C][=N][Ring1][=Branch1]"
],
"smiles": [
"CC(C)(C)OC(=O)Oc1cc(-c2cccc(-c3ccc(OCc4ccccc4)cc3)c2)nn1-c1ccccn1"
]
}
|
CC(C)(C)OC(=O)Oc1cc(-c2cccc(I)c2)nn1-c1ccccn1.OB(O)c1ccc(OCc2ccccc2)cc1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>",
"role": "user"
},
{
"content": "CC(C)(C)OC(=O)Oc1cc(-c2cccc(I)c2)nn1-c1ccccn1.OB(O)c1ccc(OCc2ccccc2)cc1",
"role": "assistant"
}
] |
362
|
{
"selfies": [
"[O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][O][C][C][N][=C][C][=C][C][=C][N][Ring1][=Branch1][C][=Ring1][=Branch2][C][#C][C][=C][C][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][#Branch2]"
],
"smiles": [
"OCc1ccccc1OCc1nc2ccccn2c1C#Cc1cccc(C(F)(F)F)c1"
]
}
|
COC(=O)c1ccccc1OCc1nc2ccccn2c1C#Cc1cccc(C(F)(F)F)c1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>",
"role": "user"
},
{
"content": "COC(=O)c1ccccc1OCc1nc2ccccn2c1C#Cc1cccc(C(F)(F)F)c1",
"role": "assistant"
}
] |
363
|
{
"selfies": [
"[C][C][Branch1][C][C][C][Branch2][Ring1][Ring1][N][C][C][Branch1][C][N][C][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][C][=Branch1][C][=O][N][C][Branch2][Ring1][#Branch1][C][C][=C][C][=C][Branch1][C][O][C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][=C][Ring1][O][C][=N][C][=C][S][Ring1][Branch1]"
],
"smiles": [
"CC(C)C(NCC(N)Cc1ccc(F)cc1)C(=O)NC(Cc1ccc(O)c(C(C)(C)C)c1)c1nccs1"
]
}
|
CC(C)C(NCC(Cc1ccc(F)cc1)NC(=O)OC(C)(C)C)C(=O)NC(Cc1ccc(O)c(C(C)(C)C)c1)c1nccs1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>",
"role": "user"
},
{
"content": "CC(C)C(NCC(Cc1ccc(F)cc1)NC(=O)OC(C)(C)C)C(=O)NC(Cc1ccc(O)c(C(C)(C)C)c1)c1nccs1",
"role": "assistant"
}
] |
364
|
{
"selfies": [
"[N][C][C][N][C][C][C][Branch2][Ring1][O][N][C][=N][C][=C][N][=C][N][=C][Ring1][=Branch1][N][Ring1][=Branch2][C][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][C][C][Ring2][Ring1][Branch2]"
],
"smiles": [
"NCCN1CCC(Nc2nc3cncnc3n2Cc2ccc(F)cc2)CC1"
]
}
|
N#CCN1CCC(Nc2nc3cncnc3n2Cc2ccc(F)cc2)CC1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "What reactants could lead to the production of the following product? <molecule_2d>",
"role": "user"
},
{
"content": "N#CCN1CCC(Nc2nc3cncnc3n2Cc2ccc(F)cc2)CC1",
"role": "assistant"
}
] |
365
|
{
"selfies": [
"[C][C][Branch1][C][C][C][C][C][Branch1][C][C][Branch1][C][C][C][=C][C][Branch2][Ring2][Ring1][C][=C][C][Branch1][S][C][=C][C][=C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][=C][Ring1][=Branch2][=C][C][=C][Ring1][#C][O][C][C][N][C][C][C][Ring1][Ring1][=C][C][=C][Ring2][Ring1][N][Ring2][Ring2][Ring1]"
],
"smiles": [
"CC1(C)CCC(C)(C)c2cc(-c3cc(-c4ccc(C(=O)O)cc4)ccc3OCCNC3CC3)ccc21"
]
}
|
CCOC(=O)c1ccc(-c2ccc(OCCNC3CC3)c(-c3ccc4c(c3)C(C)(C)CCC4(C)C)c2)cc1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?",
"role": "user"
},
{
"content": "CCOC(=O)c1ccc(-c2ccc(OCCNC3CC3)c(-c3ccc4c(c3)C(C)(C)CCC4(C)C)c2)cc1",
"role": "assistant"
}
] |
366
|
{
"selfies": [
"[C][C][=Branch1][C][=O][N][C][C][N][Branch2][Ring2][S][C][=N][C][=C][Branch1][=Branch2][N][C][C][O][C][C][Ring1][=Branch1][N][=C][Branch1][N][C][=C][N][=C][Branch1][C][N][N][=C][Ring1][#Branch1][N][=C][Ring2][Ring1][Ring1][N][Ring2][Ring1][=Branch1][C][C][Branch1][C][F][Branch1][C][F][F][C][C][Ring2][Ring1][P][C][C][Ring1][Ring1]"
],
"smiles": [
"CC(=O)N1CCN(c2nc3c(N4CCOCC4)nc(-c4cnc(N)nc4)nc3n2CC(F)(F)F)CC12CC2"
]
}
|
CC(=O)OC(C)=O.Nc1ncc(-c2nc(N3CCOCC3)c3nc(N4CCNC5(CC5)C4)n(CC(F)(F)F)c3n2)cn1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>",
"role": "user"
},
{
"content": "CC(=O)OC(C)=O.Nc1ncc(-c2nc(N3CCOCC3)c3nc(N4CCNC5(CC5)C4)n(CC(F)(F)F)c3n2)cn1",
"role": "assistant"
}
] |
367
|
{
"selfies": [
"[N][C][C][C][C][N][Branch2][Ring2][=N][C][=C][Branch2][Ring1][O][N][C][=Branch1][C][=O][C][=C][S][C][Branch1][=N][C][=C][Branch1][C][F][C][=C][C][=C][Ring1][#Branch1][F][=N][Ring1][=N][C][=N][C][=C][C][=C][C][=C][Ring2][Ring1][#Branch2][Ring1][=Branch1][C][Ring2][Ring1][S]"
],
"smiles": [
"NC1CCCN(c2c(NC(=O)c3csc(-c4c(F)cccc4F)n3)cnc3ccccc23)C1"
]
}
|
CC(C)(C)OC(=O)NC1CCCN(c2c(NC(=O)c3csc(-c4c(F)cccc4F)n3)cnc3ccccc23)C1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?",
"role": "user"
},
{
"content": "CC(C)(C)OC(=O)NC1CCCN(c2c(NC(=O)c3csc(-c4c(F)cccc4F)n3)cnc3ccccc23)C1",
"role": "assistant"
}
] |
368
|
{
"selfies": [
"[O][=N+1][Branch1][C][O-1][C][=C][C][=C][Branch1][=Branch2][N][C][C][O][C][C][Ring1][=Branch1][C][=C][Ring1][N][N][C][C][C][C][C][Ring1][=Branch1]"
],
"smiles": [
"O=[N+]([O-])c1ccc(N2CCOCC2)cc1N1CCCCC1"
]
}
|
C1COCCN1.O=[N+]([O-])c1ccc(Cl)cc1N1CCCCC1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Do retrosynthesis with the product <molecule_2d> .",
"role": "user"
},
{
"content": "OK. The reactants may be C1COCCN1.O=[N+]([O-])c1ccc(Cl)cc1N1CCCCC1 .",
"role": "assistant"
}
] |
369
|
{
"selfies": [
"[C][#C][C][Branch1][#Branch1][C][C][=Branch1][C][=O][O][N][C][=Branch1][C][=O][C][C][C][C][N][Branch2][Ring1][=C][C][=Branch1][C][=O][C][C][C][C][C][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][C][Ring1][=N][C][Ring2][Ring1][#Branch1]"
],
"smiles": [
"C#CC(CC(=O)O)NC(=O)C1CCCN(C(=O)CCC2CCN(C(=O)OC(C)(C)C)CC2)C1"
]
}
|
C#CC(CC(=O)OCC)NC(=O)C1CCCN(C(=O)CCC2CCN(C(=O)OC(C)(C)C)CC2)C1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "What reactants could lead to the production of the following product? <molecule_2d>",
"role": "user"
},
{
"content": "C#CC(CC(=O)OCC)NC(=O)C1CCCN(C(=O)CCC2CCN(C(=O)OC(C)(C)C)CC2)C1",
"role": "assistant"
}
] |
370
|
{
"selfies": [
"[C][C][Branch1][C][C][C][O][C][=Branch1][C][=O][N][C][C][C][N][Branch2][Ring2][Branch1][C][C][Branch1][C][O][C][O][C][=C][C][=C][Branch1][O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring1][=C][C][C][C][=Branch1][C][=O][N][Ring1][#Branch1][C][C][Ring2][Ring1][=C]"
],
"smiles": [
"CC(C)COC(=O)NC1CCN(CC(O)COc2ccc(OCc3ccccc3)c3c2CCC(=O)N3)CC1"
]
}
|
CC(C)COC(=O)NC1CCNCC1.O=C1CCc2c(OCC3CO3)ccc(OCc3ccccc3)c2N1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "What reactants could lead to the production of the following product? <molecule_2d>",
"role": "user"
},
{
"content": "CC(C)COC(=O)NC1CCNCC1.O=C1CCc2c(OCC3CO3)ccc(OCc3ccccc3)c2N1",
"role": "assistant"
}
] |
371
|
{
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][Branch1][N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][C][Branch2][Ring1][Ring2][O][C][=Branch1][C][=O][C][=C][C][=C][C][=C][C][=C][C][Ring1][=Branch1][=C][Ring1][#Branch2][C][Ring2][Ring1][#Branch2]"
],
"smiles": [
"CC(C)(C)OC(=O)N1CCC(c2ccc(F)cc2)C(OC(=O)c2ccc3ccccc3c2)C1"
]
}
|
CC(C)(C)OC(=O)N1CCC(c2ccc(F)cc2)C(O)C1.O=C(Cl)c1ccc2ccccc2c1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>",
"role": "user"
},
{
"content": "CC(C)(C)OC(=O)N1CCC(c2ccc(F)cc2)C(O)C1.O=C(Cl)c1ccc2ccccc2c1",
"role": "assistant"
}
] |
372
|
{
"selfies": [
"[O][=C][Branch1][#Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][F][N][C][C][N][Branch2][Ring1][=Branch1][C][=N][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][C][=C][C][=C][Ring1][=N][Ring1][=Branch1][C][C][Ring2][Ring1][Ring1]"
],
"smiles": [
"O=C(c1ccccc1F)N1CCN(c2ncc([N+](=O)[O-])c3ccccc23)CC1"
]
}
|
O=C(c1ccccc1F)N1CCNCC1.O=[N+]([O-])c1cnc(Cl)c2ccccc12
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Given the following product, please provide possible reactants. <molecule_2d>",
"role": "user"
},
{
"content": "Possible reactant(s): O=C(c1ccccc1F)N1CCNCC1.O=[N+]([O-])c1cnc(Cl)c2ccccc12 .",
"role": "assistant"
}
] |
373
|
{
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][N][=C][C][=C][C][=C][Branch2][Ring1][Ring1][N][N][=C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][C][=C][Ring1][=Branch2][N][C][=C][Ring1][S][Ring2][Ring1][Ring1]"
],
"smiles": [
"CC(C)(C)OC(=O)n1ncc2ccc(-n3nc(C(C)(C)C)cc3N)cc21"
]
}
|
CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.CC(C)(C)c1cc(N)n(-c2ccc3cn[nH]c3c2)n1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?",
"role": "user"
},
{
"content": "CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.CC(C)(C)c1cc(N)n(-c2ccc3cn[nH]c3c2)n1",
"role": "assistant"
}
] |
374
|
{
"selfies": [
"[C][C][Branch1][Ring1][C][=O][C][C][C][C][C][Branch1][C][O][C][C][C][C][Ring1][#Branch2][Ring1][#Branch1][C]"
],
"smiles": [
"CC(C=O)C1CCC2C(O)CCCC12C"
]
}
|
CC(CO)C1CCC2C(O)CCCC12C
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>",
"role": "user"
},
{
"content": "CC(CO)C1CCC2C(O)CCCC12C",
"role": "assistant"
}
] |
375
|
{
"selfies": [
"[N][C][=Branch1][C][=O][C][=C][C][=C][Branch2][Ring1][#Branch1][O][C][=C][C][=C][Branch1][N][C][N][C][C][C][=C][C][=C][S][Ring1][Branch1][C][=C][Ring1][#C][C][Branch1][C][Cl][=C][Ring2][Ring1][#Branch1]"
],
"smiles": [
"NC(=O)c1ccc(Oc2ccc(CNCCc3cccs3)cc2)c(Cl)c1"
]
}
|
NC(=O)c1ccc(Oc2ccc(C=O)cc2)c(Cl)c1.NCCc1cccs1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.",
"role": "user"
},
{
"content": "Here are possible reactants: NC(=O)c1ccc(Oc2ccc(C=O)cc2)c(Cl)c1.NCCc1cccs1 .",
"role": "assistant"
}
] |
376
|
{
"selfies": [
"[C][N][Branch1][=C][C][C][C][=C][C][=C][Branch1][C][N][C][=C][Ring1][#Branch1][C][C][N][N][=C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring1][#Branch2][=O]"
],
"smiles": [
"CN(CCc1ccc(N)cc1)CCn1ncc2ccccc2c1=O"
]
}
|
CN(CCc1ccc([N+](=O)[O-])cc1)CCn1ncc2ccccc2c1=O
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?",
"role": "user"
},
{
"content": "CN(CCc1ccc([N+](=O)[O-])cc1)CCn1ncc2ccccc2c1=O",
"role": "assistant"
}
] |
377
|
{
"selfies": [
"[C][=C][C][C][C][C][C][C][C][C][=Branch1][C][=O][N][Branch1][C][C][C][=C][C][Branch1][C][C][=C][Branch2][Ring2][Ring1][C][C][S][=Branch1][C][=O][=Branch1][C][=O][N][C][C][C][Branch1][Branch1][C][C][Ring1][=Branch1][N][=C][Branch1][#Branch1][C][C][C][C][C][=C][N][C][Ring1][=N][=O][C][Branch1][C][C][=C][Ring2][Ring1][=C]"
],
"smiles": [
"C=CCCCCCCCC(=O)N(C)c1cc(C)c(CCS(=O)(=O)N2CCC3(CC2)N=C(CCCCC=C)NC3=O)c(C)c1"
]
}
|
C=CCCCCC1=NC2(CCN(S(=O)(=O)CCc3c(C)cc(NC)cc3C)CC2)C(=O)N1.C=CCCCCCCCC(=O)Cl
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.",
"role": "user"
},
{
"content": "C=CCCCCC1=NC2(CCN(S(=O)(=O)CCc3c(C)cc(NC)cc3C)CC2)C(=O)N1.C=CCCCCCCCC(=O)Cl",
"role": "assistant"
}
] |
378
|
{
"selfies": [
"[N][C][C][C][C][Branch2][Ring1][P][C][=Branch1][C][=O][N][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][=Branch1][C][=O][N][C][=C][C][=C][Branch1][C][Cl][C][=N][Ring1][#Branch1][C][C][Ring2][Ring1][#Branch2]"
],
"smiles": [
"NC1CCC(C(=O)Nc2ccc(Cl)cc2C(=O)Nc2ccc(Cl)cn2)CC1"
]
}
|
CC(C)(C)OC(=O)NC1CCC(C(=O)Nc2ccc(Cl)cc2C(=O)Nc2ccc(Cl)cn2)CC1
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>",
"role": "user"
},
{
"content": "CC(C)(C)OC(=O)NC1CCC(C(=O)Nc2ccc(Cl)cc2C(=O)Nc2ccc(Cl)cn2)CC1",
"role": "assistant"
}
] |
379
|
{
"selfies": [
"[O][=C][C][=Branch1][C][=O][N][Branch2][Ring2][#Branch1][C][C][C][N][C][C][N][Branch2][Ring1][Branch2][C][=Branch1][C][=O][N][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][Ring2][Ring1][Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring2][Ring2][C]"
],
"smiles": [
"O=C1C(=O)N(CCCN2CCN(C(=O)N(c3ccccc3)c3ccccc3)CC2)c2ccccc21"
]
}
|
O=C(Cl)N(c1ccccc1)c1ccccc1.O=C1C(=O)N(CCCN2CCNCC2)c2ccccc21
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.",
"role": "user"
},
{
"content": "Here are possible reactants: O=C(Cl)N(c1ccccc1)c1ccccc1.O=C1C(=O)N(CCCN2CCNCC2)c2ccccc21 .",
"role": "assistant"
}
] |
380
|
{
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][N][Branch2][Ring1][Branch2][C][C][=C][C][=N][N][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][N][Ring1][=Branch2][C][=Ring1][=N][C][C][Ring2][Ring1][Ring1]"
],
"smiles": [
"CC(C)(C)OC(=O)N1CCN(c2ccc3nnc(C(F)(F)F)n3c2)CC1"
]
}
|
CC(C)(C)OC(=O)N1CCNCC1.FC(F)(F)c1nnc2ccc(Br)cn12
|
[
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "What reactants could lead to the production of the following product? <molecule_2d>",
"role": "user"
},
{
"content": "CC(C)(C)OC(=O)N1CCNCC1.FC(F)(F)c1nnc2ccc(Br)cn12",
"role": "assistant"
}
] |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.