instruction
stringclasses 1
value | output
stringlengths 52
197
| input
stringlengths 75
717
| history
listlengths 0
0
|
|---|---|---|---|
The chemical solvents used here are CCN(CC)CC and CO. ### The answer is CCN(CC)CC and CO
|
What solvents are employed in the chemical reaction represented by Cl.CNC.BrCCOc1cc(-c2ccccc2)on1.CCN(CC)CC>>CN(C)CCOc1cc(-c2ccccc2)on1.?
|
[] |
|
This chemical reaction utilizes CC(=O)O as its solvents. ### The answer is CC(=O)O
|
In the reaction with SMILES notation BrBr.CS(=O)(=O)c1ccc(O)cc1>>CS(=O)(=O)c1ccc(O)c(Br)c1., can you point out the solvents used?
|
[] |
|
Solvents C1CCOC1, CC(C)NC(C)C, and O are the substances used in this chemical reaction. ### The answer is C1CCOC1, CC(C)NC(C)C, and O
|
Do you know which solvents enhance the reaction represented by the SMILES sequence [Li]CCCC.CC(C)NC(C)C.Clc1cc(Cl)ncn1.O=CC1CC1>>OC(c1c(Cl)ncnc1Cl)C1CC1.?
|
[] |
|
CC#N serve as the solvents in this chemical reaction. ### The answer is CC#N
|
What solvents can be found in the reaction denoted by the SMILES CCOC(=O)C(Cc1ccc(OCc2ccccc2)c(OC)c1)OCC.O=C([O-])[O-].[K+].[K+].Cc1ccc(S(=O)(=O)OCCc2ccc(NC(=O)OC(C)(C)C)cc2)cc1>>CCOC(=O)C(Cc1ccc(OCCc2ccc(NC(=O)OC(C)(C)C)cc2)c(OC)c1)OCC.?
|
[] |
|
C1CCOC1 are the solvents involved in this chemical process. ### The answer is C1CCOC1
|
Can you tell me the solvents that react with the SMILES COc1ccc[nH]c1=O.O=C([O-])[O-].[K+].[K+].BrCc1ccc(Br)cc1>>COc1cccn(Cc2ccc(Br)cc2)c1=O.?
|
[] |
|
The chemical reaction makes use of solvents CCN(C(C)C)C(C)C, CCOC(C)=O, and CN(C)C=O. ### The answer is CCN(C(C)C)C(C)C, CCOC(C)=O, and CN(C)C=O
|
Would you please tell me what solvent medium is used in the reaction corresponding to the SMILES O=C(O)c1cncc(Br)c1.NC1CCCCC1.CCN(C(C)C)C(C)C.CN(C)C(On1nnc2cccnc21)=[N+](C)C.F[P-](F)(F)(F)(F)F>>O=C(NC1CCCCC1)c1cncc(Br)c1.?
|
[] |
|
Solvents CO and O are integral to this chemical reaction's process. ### The answer is CO and O
|
Please enlighten me with the solvents that have been used in the reaction relating to the SMILES notation CCOC(=O)CCCCC(C#N)c1cccc2ccccc12.[OH-].[Na+]>>N#CC(CCCCC(=O)O)c1cccc2ccccc12..
|
[] |
|
CN(C)C=O are the solvents incorporated in this chemical reaction. ### The answer is CN(C)C=O
|
Can you name the solvents used in the reaction depicted by the SMILES code CCCCC1(C2CCCC2)Cc2cc(O)c(Cl)c(Cl)c2C1=O.O=C([O-])[O-].[K+].[K+].O=S(=O)(Cl)C(F)(F)F>>CCCCC1(C2CCCC2)Cc2cc(OS(=O)(=O)C(F)(F)F)c(Cl)c(Cl)c2C1=O.?
|
[] |
|
This chemical reaction incorporates CCN(CC)CC and ClCCl as solvents. ### The answer is CCN(CC)CC and ClCCl
|
Can you specify the dissolving agents used in the reaction with the SMILES CC(C)(C)OC(=O)N[C@@H]1CCN(c2ccc(Br)cn2)C1.O=C(O)C(F)(F)F.O=C(O)C(F)F.CCN=C=NCCCN(C)C.On1nnc2ccccc21.CCN(CC)CC>>O=C(N[C@@H]1CCN(c2ccc(Br)cn2)C1)C(F)F.?
|
[] |
|
The reaction uses CN(C)C=O as its solvents. ### The answer is CN(C)C=O
|
What could be the solvent substances involved in the reaction that has the SMILES code Fc1c(Cl)cccc1CBr.[N-]=C=S.[K+].[Na+].[I-]>>Fc1c(Cl)cccc1CN=C=S.?
|
[] |
|
The chemical reaction makes use of solvents Cc1ccccc1. ### The answer is Cc1ccccc1
|
What dissolving substances are used in the reaction that includes the SMILES CC(C)(C)OC(=O)N1CCC2(CCNCC2)C1.Fc1ccc(Br)cc1.c1ccc(P(c2ccccc2)c2ccc3ccccc3c2-c2c(P(c3ccccc3)c3ccccc3)ccc3ccccc23)cc1>>CC(C)(C)OC(=O)N1CCC2(CCN(c3ccc(F)cc3)CC2)C1.?
|
[] |
|
CCOCC are the chosen solvents for this chemical reaction. ### The answer is CCOCC
|
Could you point out the solvent substances included in the reaction characterized by the SMILES code Clc1ccc(-c2nccs2)cc1.[Li]CCCC.ICCI.[Cl-].[NH4+]>>Clc1ccc(-c2ncc(I)s2)cc1.?
|
[] |
|
Solvents C1=CCCC=CCC1, C1COCCO1, and O are the substances used in this chemical reaction. ### The answer is C1=CCCC=CCC1, C1COCCO1, and O
|
I'm wondering what solvents help provoke the reaction shown in the SMILES sequence OB(O)c1ccccc1.O=C1C=CCCC1.O>>c1ccc(C2CCCCC2)cc1.?
|
[] |
|
Solvents O and Clc1ccccc1Cl play a role in this chemical reaction. ### The answer is O and Clc1ccccc1Cl
|
What are the solvents that facilitate the SMILES sequence CC(NC(=O)c1cccc(I)c1)C(O)c1ccccc1.O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3.O>>Cc1cc2ccccc2c(-c2cccc(I)c2)n1. reaction?
|
[] |
|
For this chemical reaction, ClCCl act as solvents. ### The answer is ClCCl
|
Which solvents does the O=C(Cl)C(=O)Cl.Cl.O=C(O)CC1CCN(Cc2cc(-c3ccccc3)no2)CC1>>Cl.O=C(Cl)CC1CCN(Cc2cc(-c3ccccc3)no2)CC1. reaction contain?
|
[] |
|
This chemical reaction incorporates CCN(CC)CC and ClCCl as solvents. ### The answer is CCN(CC)CC and ClCCl
|
Would you please clarify which solvents exist in the Cl.O=S(=O)(Cl)c1cccc2cnccc12.CC(C)(C)OC(=O)N1CCCNCC1.CCN(CC)CC>>CC(C)(C)OC(=O)N1CCCN(S(=O)(=O)c2cccc3cnccc23)CC1. reaction?
|
[] |
|
C1CCOC1, CC(=O)N(C)C, CO, and ClCCl are the solvents that facilitate this chemical reaction. ### The answer is C1CCOC1, CC(=O)N(C)C, CO, and ClCCl
|
Which solvents are included in the reaction with the SMILES notation O=C(n1ccnc1)n1ccnc1.CCOP(=O)(CC(=O)O)OCC.Nc1cc2c(Nc3ccc(OCc4ccccn4)c(Cl)c3)ncnc2cn1.CC(=O)N(C)C>>CCOP(=O)(CC(=O)Nc1cc2c(Nc3ccc(OCc4ccccn4)c(Cl)c3)ncnc2cn1)OCC.?
|
[] |
|
This reaction involves O as the solvents. ### The answer is O
|
Can you identify the solvents used in the CN(C)C1(C#N)CCC2(CC1)OCCO2.[NH4+].[Cl-].O.C1CCOC1>>COCCCC1(N(C)C)CCC2(CC1)OCCO2. reaction?
|
[] |
|
In this chemical reaction, solvents CCOCC, ClCCl, and c1ccncc1 are employed. ### The answer is CCOCC, ClCCl, and c1ccncc1
|
Can you tell me the solvent medium used in the reaction associated with the SMILES O=C1C=C(c2c(F)c(F)c(O)c(F)c2F)C(=O)N1.C=COCC.Cc1ccc(S(=O)(=O)O)cc1.CCOCC>>CCOC(C)Oc1c(F)c(F)c(C2=CC(=O)NC2=O)c(F)c1F.?
|
[] |
|
In this chemical reaction, the solvents are CN(C)C=O and ClCCl. ### The answer is CN(C)C=O and ClCCl
|
Do you know the dissolving agents in the reaction related to the SMILES COC(=O)[C@@H]1CCCN1.C(=NC1CCCCC1)=NC1CCCCC1.Cc1ccc(C(=O)O)c(O)c1[N+](=O)[O-].ClCCl>>COC(=O)[C@@H]1CCCN1c1ccc(C)c([N+](=O)[O-])c1O.?
|
[] |
|
For the chemical reaction, solvents O are used. ### The answer is O
|
What solvents take part in the reaction alongside the SMILES CC(C)C(C)(NC(=O)c1nc2ccccc2cc1C(=O)O)C(N)=O.[OH-].[Na+].Cl>>CC(C)C1(C)N=C(c2nc3ccccc3cc2C(=O)O)NC1=O.?
|
[] |
|
The reaction uses CC(C)=O and O as its solvents. ### The answer is CC(C)=O and O
|
Could you identify the solvents employed in the O=[N+]([O-])c1ccc(F)cc1O.O=C([O-])[O-].[K+].[K+].C=CCBr.[O-]c1ccccc1.Cl>>C=CCOc1cc(F)ccc1[N+](=O)[O-]. reaction?
|
[] |
|
The reaction uses BrCCBr as its solvents. ### The answer is BrCCBr
|
What solvents are being used in handling the reaction of SMILES c1nc[nH]n1.CCOC(=O)c1cc(C(=O)OCC)[nH]n1.ClCCBr.BrCCBr>>ClCCn1ccnn1.c1nc[nH]n1.?
|
[] |
|
CO are the solvents that this reaction requires. ### The answer is CO
|
Do you know which solvents enhance the reaction represented by the SMILES sequence C[C@H](Oc1ccc([N+](=O)[O-])cn1)C(F)(F)F.[H][H]>>C[C@H](Oc1ccc(N)cn1)C(F)(F)F.?
|
[] |
|
C1CCOC1 and CO serve as the solvents in this chemical reaction. ### The answer is C1CCOC1 and CO
|
Could you specify the solvents participating in the SMILES COc1ccc(Cn2nc(/C=C/c3cc(Oc4cc(Cl)cc(C#N)c4)c(Cl)c(OC)n3)c3ccc(F)nc32)cc1.[H][H]>>COc1ccc(Cn2nc(CCc3cc(Oc4cc(Cl)cc(C#N)c4)c(Cl)c(OC)n3)c3ccc(F)nc32)cc1. reaction?
|
[] |
|
The solvents in this chemical reaction are O. ### The answer is O
|
May I know the solvents utilized in the reaction that incorporates the SMILES notation O=S(=O)(Cl)c1cc(Br)cc(Br)c1.CC(C)N>>CC(C)NS(=O)(=O)c1cc(Br)cc(Br)c1.?
|
[] |
|
The reaction uses CN(C)C=O as solvents. ### The answer is CN(C)C=O
|
Would you tell me what the solvent substances are in the reaction with the SMILES code CCCC[Sn](CCCC)(CCCC)c1cn(S(=O)(=O)c2ccc(C)cc2)c2ccc(C#N)cc12.CCOC(=O)C1=C(OS(=O)(=O)C(F)(F)F)CCC1.c1ccc([As](c2ccccc2)c2ccccc2)cc1>>CCOC(=O)C1=C(c2cn(S(=O)(=O)c3ccc(C)cc3)c3ccc(C#N)cc23)CCC1.?
|
[] |
|
O and c1ccccc1, the solvents, are used in this chemical reaction. ### The answer is O and c1ccccc1
|
Could you identify the solvents involved in the SMILES-determined reaction CCOC(=O)C1CCNCC1.CC1(C)CS1.O>>CCOC(=O)C1CCN(CC(C)(C)S)CC1.?
|
[] |
|
The reaction is conducted using solvents O=[N+]([O-])O. ### The answer is O=[N+]([O-])O
|
Do you have information on the solvents used in the Nc1ccc(Br)cc1[N+](=O)[O-].Nc1ccc(Br)cc1.CC(=O)OC(C)=O>>CC(=O)Nc1ccc(Br)cc1[N+](=O)[O-]. reaction scenario?
|
[] |
|
Solvents CCN(CC)CC and CN(C)C=O are the substances used in this chemical reaction. ### The answer is CCN(CC)CC and CN(C)C=O
|
What kinds of solvents are used to facilitate the reaction in the SMILES sequence FC(F)(F)c1ccc(Cl)cc1CN1CCNc2ncc(-c3ccnc(N4CCNCC4)c3)cc21.CC(=O)Cl.CCN(CC)CC>>CC(=O)N1CCN(c2cc(-c3cnc4c(c3)N(Cc3cc(Cl)ccc3C(F)(F)F)CCN4)ccn2)CC1.?
|
[] |
|
The solvents, C1COCCO1 and CCOC(C)=O, are utilized in this chemical reaction. ### The answer is C1COCCO1 and CCOC(C)=O
|
Are you aware of the solvent substances in the reaction with the SMILES code Cl.CON1CCN(C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)CC1.Cl.C1COCCO1>>Cl.CON1CCNNCC1.?
|
[] |
|
This chemical reaction is carried out with solvents CCN(C(C)C)C(C)C, CN(C)C=O, and O=CO. ### The answer is CCN(C(C)C)C(C)C, CN(C)C=O, and O=CO
|
Which are the agents responsible for dissolution in the reaction for SMILES CC(C)[C@@H]1C[C@H]1C(=O)O.CCN(C(C)C)C(C)C.CN(C)C(On1nnc2ccccc21)=[N+](C)C.F[B-](F)(F)F.Cl.CCOC(=O)COc1ccc(Cl)cc1[C@H]1NCCc2ccccc21>>CC(C)[C@@H]1C[C@H]1C(=O)N1CCc2ccccc2[C@H]1c1cc(Cl)ccc1OCC(=O)O.?
|
[] |
|
In this reaction, CN(C)C=O and ClCCCl act as the solvents. ### The answer is CN(C)C=O and ClCCCl
|
Can you name the solvents used in the reaction depicted by the SMILES code NC1CC1.CC(C)(C)OC(=O)N1C[C@H](O)C[C@@H]1C(=O)O.ClCCCl.On1nnc2ccccc21>>CC(C)(C)OC(=O)N1C[C@H](O)C[C@@H]1C(=O)NC1CC1.?
|
[] |
|
This chemical process is carried out using solvents CI and C1CCOC1. ### The answer is CI and C1CCOC1
|
Can you specify the dissolving agents used in the reaction with the SMILES [Li+].CC(C)[N-]C(C)C.C[C@H]1COCCN1c1nc(Cl)nc2c1CS(=O)(=O)C2(C)C.CI>>CC1c2c(N3CCOC[C@@H]3C)nc(Cl)nc2C(C)(C)S1(=O)=O.?
|
[] |
|
In this chemical reaction, CCOC(C)=O, CO, and O are the solvents. ### The answer is CCOC(C)=O, CO, and O
|
Could you identify the solvents involved in the SMILES-determined reaction C[C@H](O)[C@@](O)(CCl)c1ccc(F)cc1F.C[O-].[Na+].O.CCOC(C)=O>>C[C@H](O)[C@]1(c2ccc(F)cc2F)CO1.?
|
[] |
|
The solvents for this reaction are CCO. ### The answer is CCO
|
In carrying out the reaction involving Cl.CN(C)c1ccccc1CCl.CC1(C)NC(SCc2ccccc2)=NC1=S>>CN(C)c1ccccc1CSC1=NC(SCc2ccccc2)=NC1(C)C., what solvents were employed?
|
[] |
|
Solvents ClCCl and CCN(CC)CC are used in this particular chemical reaction. ### The answer is ClCCl and CCN(CC)CC
|
Do you know the solvents that are part of the reaction with the SMILES CC(=O)c1cccc(O)c1.C[Si](C)(C)OS(=O)(=O)C(F)(F)F.CCN(CC)CC.CC(C)c1ccccc1SC(C(=O)O)C(=O)O>>CC(C)c1ccccc1Sc1c(O)cc(-c2cccc(O)c2)oc1=O.?
|
[] |
|
CCN(C(C)C)C(C)C, CN(C)C=O, ClCCl, and O are the solvents that facilitate this chemical reaction. ### The answer is CCN(C(C)C)C(C)C, CN(C)C=O, ClCCl, and O
|
Could you point out the solvent substances included in the reaction characterized by the SMILES code CS(=O)(=O)O.Cc1nc2c(N)cc(C(N)=O)cn2c1C.CCc1cccc(CC)c1CCl.CCN(C(C)C)C(C)C.O>>Cc1cccc(C)c1CNc1cc(C(N)=O)cn2c(C)c(C)nc12.?
|
[] |
|
This chemical process uses C1CCOC1 as the solvents. ### The answer is C1CCOC1
|
Could you tell me what solvents accelerate the reaction denoted by the SMILES sequence .[Al+3].[Li+].[H].[H].[H].[H]O=C1CN2CCC(CC2)N1>>C1CN2CCC(CC2)N1.?
|
[] |
|
In this chemical reaction, solvents CCOCC are employed. ### The answer is CCOCC
|
Can you list the solvents that participate in the reaction involving the SMILES [O-]C(C(F)(F)F)(C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F.[K+].C=C(F)C(=O)Cl>>C=C(F)C(=O)OC(C(F)(F)F)(C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F.?
|
[] |
|
O=CO are the solvents that facilitate this chemical reaction. ### The answer is O=CO
|
Can you specify the dissolving agents used in the reaction with the SMILES COC(=O)c1ncc(COc2ccc(F)cc2)c2c1OC(C)(C)OC2>>COC(=O)c1ncc(COc2ccc(F)cc2)c(CO)c1O.?
|
[] |
|
The solvents participating in this chemical reaction are C1CCOC1 and O. ### The answer is C1CCOC1 and O
|
Can you identify the particular solvent medium that is connected with the SMILES COc1c(Cl)ccnc1CC#N.[H].[H][Na+].CCI>>CCC(C#N)c1nccc(Cl)c1OC. reaction?
|
[] |
|
The chemical reaction utilizes CCCCCC and CCOCC as solvents. ### The answer is CCCCCC and CCOCC
|
Do you know the solvents that are part of the reaction with the SMILES Fc1ccc(Br)c(F)c1.[Li]CCCC.CC(=O)OCC(=O)COC(C)=O.Cl>>CC(=O)OCC(O)(COC(C)=O)c1ccc(F)cc1F.?
|
[] |
|
The solvents for this reaction are CCO. ### The answer is CCO
|
Can you list the solvents used in the [OH-].[Na+].CCOC(=O)c1cn(-c2ncccn2)nc1Cl>>O=C(O)c1cn(-c2ncccn2)nc1Cl. reaction?
|
[] |
|
This chemical reaction is performed with CO as solvents. ### The answer is CO
|
Please specify, what are the solvents present in the reaction with the SMILES [OH-].[Na+].CCC(CC)(c1ccc(CCC(O)(C(F)(F)F)C(F)(F)F)c(C)c1)c1ccc(-c2ccc(CC(=O)OC)c(F)c2)c(C)c1.[Cl-].[NH4+]>>CCC(CC)(c1ccc(CCC(O)(C(F)(F)F)C(F)(F)F)c(C)c1)c1ccc(-c2ccc(CC(=O)O)c(F)c2)c(C)c1.?
|
[] |
|
The solvents CCCCCC and CO are integral to this chemical reaction. ### The answer is CCCCCC and CO
|
What solvents take part in the reaction alongside the SMILES CC(C)C[C@H](NC(=O)CNC(=O)c1ccccc1Br)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1.Cl.CC(C)COB[O-]>>CC(C)C[C@H](NC(=O)CNC(=O)c1ccccc1Br)B(O)O.?
|
[] |
|
C1COCCO1 are the solvents involved in this chemical process. ### The answer is C1COCCO1
|
What are the solvents that facilitate the SMILES sequence COC(=O)c1cccnc1.O=C1CCCO1.C[O-].[Na+].Cl.O=C([O-])O.[Na+]>>CCC(Cl)C(=O)c1cccnc1. reaction?
|
[] |
|
In this chemical reaction, solvents CCN(C(C)C)C(C)C and CS(C)=O are employed. ### The answer is CCN(C(C)C)C(C)C and CS(C)=O
|
Would you please tell me what solvent medium is used in the reaction corresponding to the SMILES CC(Nc1ncnc2cc(C(=O)O)c(Cl)cc12)c1nc2cc(Cl)ccc2[nH]1.CN(C)C(Oc1c(F)c(F)c(F)c(F)c1F)=[N+](C)C.F[P-](F)(F)(F)(F)F.CCN(C(C)C)C(C)C.C1CSCCN1>>CC(Nc1ncnc2cc(C(=O)N3CCSCC3)c(Cl)cc12)c1nc2cc(Cl)ccc2[nH]1.?
|
[] |
|
The solvents, namely C1CCNCC1 and CCO, are used in this chemical reaction. ### The answer is C1CCNCC1 and CCO
|
What kinds of solvents are used to facilitate the reaction in the SMILES sequence CC(C)(C)c1cc(C=O)cc(C(C)(C)C)c1.N#CCc1ccccn1>>CC(C)(C)c1cc(C=C(C#N)c2ccccn2)cc(C(C)(C)C)c1.?
|
[] |
|
The reaction uses C1CCOC1 as solvents. ### The answer is C1CCOC1
|
Do you know the dissolving agents in the reaction related to the SMILES .[Na+].[I-].C[S+](C)(C)=O.CC(C)[C@@H](COCc1ccccc1)C[C@@H](C=O)NC(=O)OC(C)(C)C>>CC(C)[C@@H](COCc1ccccc1)C[C@H](NC(=O)OC(C)(C)C)[C@@H]1CO1.?
|
[] |
|
The solvents participating in this chemical reaction are ClCCl and O. ### The answer is ClCCl and O
|
Can you name the solvents used in the reaction depicted by the SMILES code Nc1c[nH]c2ncc(Br)c(F)c12.O=C(O)c1ccc(C(F)(F)F)cn1.O=C1OCCN1P(=O)(Cl)N1CCOC1=O.[Li+].[OH-]>>O=C(Nc1c[nH]c2ncc(Br)c(F)c12)c1ccc(C(F)(F)F)cn1.?
|
[] |
|
CCN(CC)CC and CN(C)C=O are the solvents that are used in this chemical reaction. ### The answer is CCN(CC)CC and CN(C)C=O
|
Can you tell me which solvents were used in the reaction involving the SMILES O=C(O)c1ccccc1.Cl.CCN=C=NCCCN(C)C.On1nnc2ccccc21.CC(C)(C)OC(=O)N1CCCC(N)C1>>CC(C)(C)OC(=O)N1CCCC(NC(=O)c2ccccc2)C1.?
|
[] |
|
The chemical reaction takes place with the use of solvents CC(=O)O and CC(C)O. ### The answer is CC(=O)O and CC(C)O
|
Can you elucidate the solvent substances associated with the reaction referred to by the SMILES code Cc1cc(CCC(=O)c2sc(C)c3c2C[C@@H]2[C@H]3C2(C)C)ccc1O.ClCC1CO1>>Cc1cc(CCC(=O)c2sc(C)c3c2C[C@@H]2[C@H]3C2(C)C)ccc1OCC1CO1.?
|
[] |
|
For this chemical reaction, CCN(C(C)C)C(C)C and CCO act as solvents. ### The answer is CCN(C(C)C)C(C)C and CCO
|
Would you be able to specify the solvents used in the reaction characterized by the SMILES code O=C(CBr)c1ccc(Cl)s1.NC(=S)NCCCN1CCOCC1.CCN(C(C)C)C(C)C.O=C(Cl)c1cccs1>>O=C(c1cccs1)N(CCCN1CCOCC1)c1nc(-c2ccc(Cl)s2)cs1.?
|
[] |
|
Solvents CO play a role in this chemical reaction. ### The answer is CO
|
Do you know which solvents enhance the reaction represented by the SMILES sequence O=C1c2ccc(Cl)cc2CCc2cccnc21.[BH4-].[Na+]>>OC1c2ccc(Cl)cc2CCc2cccnc21.?
|
[] |
|
For this reaction, CN(C)C=O are the solvents used. ### The answer is CN(C)C=O
|
Would you tell me what the solvent substances are in the reaction with the SMILES code CCCCc1ncc(/C=C2\C(=O)NC(=O)N2CCCC)n1Cc1ccc(C(=O)OC)cc1.O=C([O-])[O-].[K+].[K+].Cl.Cc1nc(CCl)cs1>>Cl.Cl.CCCCc1ncc(/C=C2\C(=O)N(Cc3csc(C)n3)C(=O)N2CCCC)n1Cc1ccc(C(=O)OC)cc1.?
|
[] |
|
CCN(CC)CC, Cc1ccccc1, and ClCCl are the solvents incorporated in this chemical reaction. ### The answer is CCN(CC)CC, Cc1ccccc1, and ClCCl
|
Could you tell me the solvents in the reaction described by the SMILES COc1ccc2c(c1)OCC(C(=O)O)=C2.CCN(CC)CC.[N-]=[N+]=NP(=O)(c1ccccc1)c1ccccc1.Cl>>COc1ccc2c(c1)OCC(=O)C2.?
|
[] |
|
This chemical reaction is facilitated by the solvents Cc1ccccc1. ### The answer is Cc1ccccc1
|
In the context of the SMILES Nc1c(Cl)ccc2c1C(=O)c1ccccc1C2=O.COS(=O)(=O)F>>CNc1c(Cl)ccc2c1C(=O)c1ccccc1C2=O. reaction, could you state the solvent medium?
|
[] |
|
CCN(CC)CC are utilized as the solvents in this chemical reaction. ### The answer is CCN(CC)CC
|
Would you mind sharing the solvent medium in the reaction that corresponds to the SMILES COCCc1nc2c(N)nc3ccccc3c2n1CCCCCCCCN.CCN(CC)CC.O=S(=O)(Cl)c1ccccc1>>COCCc1nc2c(N)nc3ccccc3c2n1CCCCCCCCNS(=O)(=O)c1ccccc1.?
|
[] |
|
CC(=O)O, CCOC(C)=O, and CO, the solvents, are used in this chemical reaction. ### The answer is CC(=O)O, CCOC(C)=O, and CO
|
Can you list the solvents that participate in the reaction involving the SMILES CC(C)(C)OC(=O)N[C@H](COc1cncc(-c2ccc(C=O)cc2)c1)Cc1c[nH]c2ccccc12.Nc1ccccc1.[BH3-]C#N.[Na+].CC(=O)O>>CC(C)(C)OC(=O)N[C@H](COc1cncc(-c2ccc(CNc3ccccc3)cc2)c1)Cc1c[nH]c2ccccc12.?
|
[] |
|
The chemical reaction makes use of solvents CN(C)C=O and O. ### The answer is CN(C)C=O and O
|
What types of solvents were used for the reaction with the SMILES Cc1[nH]cnc1C(F)(F)C(F)(F)F.[H].[H][Na+].FC(F)(F)c1cnc(Cl)c(Cl)c1.O>>Cc1c(C(F)(F)C(F)(F)F)ncn1-c1ncc(C(F)(F)F)cc1Cl.?
|
[] |
|
ClCCl and C1CCOC1 are the solvents used in this chemical reaction. ### The answer is ClCCl and C1CCOC1
|
I would like to know the solvents in the reaction associated with the SMILES notation Cn1cncc1C(Cl)c1ccc(C#N)cc1.[NH4+].[OH-]>>Cn1cncc1C(N)c1ccc(C#N)cc1., could you tell me?
|
[] |
|
For the chemical reaction, solvents CO are used. ### The answer is CO
|
What solvents are involved in the reaction described by the SMILES notation C=C(C)c1cc(Oc2ccc(NC(=O)[C@@H](CC)N(C(=O)[O-])C(C)(C)C)cn2)ccc1C#N>>CC[C@@H](NC(=O)OC(C)(C)C)C(=O)Nc1ccc(Oc2ccc(C#N)c(C(C)C)c2)nc1.?
|
[] |
|
The solvents participating in this chemical reaction are CCOCC. ### The answer is CCOCC
|
Can you identify the solvents used in the O=C(Cl)CCCCl.CC(C)COc1ccccc1N.O=C([O-])[O-].[K+].[K+]>>CC(C)COc1ccccc1NC(=O)CCCCl. reaction?
|
[] |
|
The solvents CN(C)C=O are utilized in the chemical reaction. ### The answer is CN(C)C=O
|
What could be the solvent substances involved in the reaction that has the SMILES code CC(C)(C)OC(=O)c1ccccc1-c1ccc(CBr)cc1.O=C1NC(=O)c2ccccc21.[K]>>CC(C)(C)OC(=O)c1ccccc1-c1ccc(CN2C(=O)c3ccccc3C2=O)cc1.?
|
[] |
|
Solvents CN(C)C=O and O are employed in this chemical reaction. ### The answer is CN(C)C=O and O
|
Can you tell me the solvent medium used in the reaction associated with the SMILES Oc1c(Cl)cc(OCc2ccccc2)cc1Cl.O=C([O-])[O-].[K+].[K+].OCCBr.O>>OCCOc1c(Cl)cc(OCc2ccccc2)cc1Cl.?
|
[] |
|
CCOCC and ClCCl are the solvents that facilitate this chemical reaction. ### The answer is CCOCC and ClCCl
|
Which solvents are used in the reaction with the given SMILES OCCCCCCN1CCN(c2nc(N3CCCC3)nc(N3CCCC3)n2)CC1.CS(=O)(=O)O>>CS(=O)(=O)OCCCCCCN1CCN(c2nc(N3CCCC3)nc(N3CCCC3)n2)CC1.?
|
[] |
|
C1COCCO1 are the solvents that this chemical reaction utilizes. ### The answer is C1COCCO1
|
Could you identify the solvents employed in the CC(C)(C)OC(=O)N1CCC(CCNC(=O)c2noc(-c3ccc(C#N)cc3)n2)CC1.Cl>>Cl.N#Cc1ccc(-c2nc(C(=O)NCCC3CCNCC3)no2)cc1. reaction?
|
[] |
|
In this chemical reaction, the solvents are C1COCCO1 and CCOCC. ### The answer is C1COCCO1 and CCOCC
|
What solvents are involved in the chemical reaction that is defined by CC(C)(C)OC(=O)N1CCO[C@@H](c2ccc(-c3cnn(-c4ccc(F)cc4)c3)cc2)C1.Cl.CCOCC>>Cl.Fc1ccc(-n2cc(-c3ccc([C@H]4CNCCO4)cc3)cn2)cc1.?
|
[] |
|
For this chemical reaction, the solvents CC(C)O are used. ### The answer is CC(C)O
|
Would you please clarify which solvents exist in the O=C(NC[C@H](O)CN1CCc2ccccc2C1)c1cc(Cl)ncn1.CC(=O)N1CC(N)C1>>CC(=O)N1CC(Nc2cc(C(=O)NC[C@H](O)CN3CCc4ccccc4C3)ncn2)C1. reaction?
|
[] |
|
Solvents C1COCCO1 are employed in this chemical reaction. ### The answer is C1COCCO1
|
What solvents were applied in the reaction with the SMILES notation CC(C(=O)O)c1ccc(CBr)cc1.[N-]=[N+]=[N-].[Na+].C1COCCOCCOCCOCCO1>>CC(C(=O)O)c1ccc(CN=[N+]=[N-])cc1.?
|
[] |
|
The solvents participating in this chemical reaction are C1CCOC1. ### The answer is C1CCOC1
|
Which solvents does the COC1=C(c2c(C)cc(Br)cc2C)C(=O)CC1.C[Si](C)(C)[N-][Si](C)(C)C.[Li+].O=CC1CCOCC1>>COC1=C(c2c(C)cc(Br)cc2C)C(=O)C(C(O)C2CCOCC2)C1. reaction contain?
|
[] |
|
For this reaction, the solvents employed are CC(=O)O and CO. ### The answer is CC(=O)O and CO
|
Could you tell me the dissolving agents employed in the reaction with the SMILES Nc1cc2oc(=O)[nH]c2cc1F.O=CCCC1CCCOC1.CC(=O)O.[BH3-]C#N.[Na+]>>O=c1[nH]c2cc(F)c(NCCCC3CCCOC3)cc2o1.?
|
[] |
|
CN(C)C=O and O are the solvents that make this chemical reaction possible. ### The answer is CN(C)C=O and O
|
Can you specify the solvents involved in the Cc1ccc(N(C)S(=O)(=O)c2cccs2)c2[nH]c(-c3ncc(CCl)s3)cc12.CC(=O)N1CCNCC1.O=C([O-])[O-].[K+].[K+].O>>CCN(c1ccc(C)c2cc(-c3ncc(CN4CCN(C(C)=O)CC4)s3)[nH]c12)S(=O)(=O)c1cccs1. reaction?
|
[] |
|
For this chemical reaction, the solvents C1CCOC1 and CCOCC are used. ### The answer is C1CCOC1 and CCOCC
|
Would you mind identifying the solvents within the reaction labeled as CN(C(=O)OC(C)(C)C)C1CCC(=O)CC1.FC(F)(Br)Br>>CN(C(=O)OC(C)(C)C)C1CCC(=C(F)F)CC1. SMILES?
|
[] |
|
The solvents used for this chemical reaction are C1COCCO1 and O. ### The answer is C1COCCO1 and O
|
Which solvents are involved in the reaction with the SMILES CCCC(CC(=O)OCC)n1c(=O)n(Cc2nsc3cc(C)cc(C)c23)c2ccccc21.O.[Li+].[OH-]>>CCCC(CC(=O)O)n1c(=O)n(Cc2nsc3cc(C)cc(C)c23)c2ccccc21.?
|
[] |
|
The chemical reaction involves CCO and ClCCl as the solvents used. ### The answer is CCO and ClCCl
|
Can you specify the solvents used in the reaction having the SMILES notation CCC[C@H](c1ccc(C(=O)NCCC(=O)OCC)cc1)C(c1ccc(Cl)cc1)c1ccc2cc(OC)ccc2c1.[Li+].[OH-].Cl>>CCC[C@H](c1ccc(C(=O)NCCC(=O)O)cc1)C(c1ccc(Cl)cc1)c1ccc2cc(OC)ccc2c1.?
|
[] |
|
The chemical reaction involves CC(=O)O as solvents. ### The answer is CC(=O)O
|
Could you tell me about the solvents in the reaction that includes the SMILES notation O=[N+]([O-])c1ccc(OCC2CO2)cc1.[OH-].[Na+]>>Nc1ccc(OCC(O)COCC(O)COc2ccc(N)cc2)cc1.?
|
[] |
|
This reaction involves CN(C)C=O as the solvents. ### The answer is CN(C)C=O
|
Could you tell me the solvents in the reaction described by the SMILES COC(=O)C(C(=O)OC1CCCC1)c1cn(C2CCCC2)cn1.[H].[H][Na+].CC(C)(C)OC(=O)Nc1ccc(CBr)cn1>>COC(=O)C(Cc1ccc(N)nc1)(C(=O)OC1CCCC1)c1cn(C2CCCC2)cn1.?
|
[] |
|
O=C(O)C(F)(F)F are the solvents selected for this chemical reaction. ### The answer is O=C(O)C(F)(F)F
|
What solvents can be found in the reaction denoted by the SMILES COc1cc(NC[C@@H]2CCCN2C(=O)OC(C)(C)C)ccc1Cl.C=C(C)OC.O=C(O)C(F)(F)F.CC(=O)O[BH-](OC(C)=O)OC(C)=O.[Na+]>>COc1cc(N(C[C@@H]2CCCN2)C(C)C)ccc1Cl.?
|
[] |
|
This chemical reaction is executed using solvents C1CCOC1, CO, and O. ### The answer is C1CCOC1, CO, and O
|
Can you tell me which solvents were used in the reaction involving the SMILES COC(=O)c1cc(N2CCC(NC(=O)c3[nH]c(C)c(Cl)c3Cl)CC2)c2cc(Cl)ccc2n1.[OH-].[Na+].Cl>>Cc1[nH]c(C(=O)NC2CCN(c3cc(C(=O)O)nc4ccc(Cl)cc34)CC2)c(Cl)c1Cl.?
|
[] |
|
Solvents ClC(Cl)Cl play a role in this chemical reaction. ### The answer is ClC(Cl)Cl
|
Please specify, what are the solvents present in the reaction with the SMILES CSc1cc(F)c2ncc(C(=O)NCc3ccc(Cl)cc3)c(O)c2c1.CN(C)C=O.O=C(OO)c1cccc(Cl)c1.O=S([O-])O.[Na+]>>CS(=O)c1cc(F)c2ncc(C(=O)NCc3ccc(Cl)cc3)c(O)c2c1.?
|
[] |
|
The reaction proceeds with ClCCl as solvents. ### The answer is ClCCl
|
Can you elucidate the solvent substances associated with the reaction referred to by the SMILES code Cc1c2ccccc2nc2ccccc12.O=C1CCC(=O)N1Br>>BrCc1c2ccccc2nc2ccccc12.?
|
[] |
|
This chemical reaction is facilitated by the solvents CCN(CC)CC, CN(C)C=O, and O. ### The answer is CCN(CC)CC, CN(C)C=O, and O
|
Do you know the solvents that are part of the reaction with the SMILES CCN(CC)CC.C#Cc1ccc(-c2ccc(Cl)cc2)cn1.Brc1cnc(OCCN2CCCC2)nc1>>Clc1ccc(-c2ccc(C#Cc3cnc(OCCN4CCCC4)nc3)nc2)cc1.?
|
[] |
|
The chemical reaction employs CCOC(C)=O as solvents. ### The answer is CCOC(C)=O
|
May I know the solvents utilized in the reaction that incorporates the SMILES notation CC(C)(C)OC(=O)NCc1ccc(Cl)cc1CNC(=O)[C@@H]1CCCN1C(=O)[C@H](O)C1CCCCC1>>NCc1ccc(Cl)cc1CNC(=O)[C@@H]1CCCN1C(=O)[C@H](O)C1CCCCC1.?
|
[] |
|
Solvents ClCCl are the substances used in this chemical reaction. ### The answer is ClCCl
|
Can you tell me the solvent medium used in the reaction associated with the SMILES Cn1cc(Br)c(N)n1.O=C(Cl)OCC(Cl)(Cl)Cl>>Cn1cc(Br)c(N(C(=O)OCC(Cl)(Cl)Cl)C(=O)OCC(Cl)(Cl)Cl)n1.?
|
[] |
|
The chemical solvents C1CCOC1 are used in this reaction. ### The answer is C1CCOC1
|
What are the solvents present in the reaction process of SMILES Cn1nnn(-c2cc([N+](=O)[O-])ccc2F)c1=O.CC(C)(C)[O-].[K+].CC(C)(C)[Si](C)(C)OCCO>>Cn1nnn(-c2cc([N+](=O)[O-])ccc2OCCO[Si](C)(C)C(C)(C)C)c1=O.?
|
[] |
|
In this reaction, the chemicals ClCCl and O=C(O)C(F)(F)F are utilized as solvents. ### The answer is ClCCl and O=C(O)C(F)(F)F
|
Could you specify the solvents that assist in triggering the reaction derived from the SMILES sequence O=C(O)C(F)(F)F.CC1CCc2ncnc(-c3ccc(O[C@@H](CN(C(=O)OC(C)(C)C)C(C)C)c4ccc(Cl)cc4)cc3)c21>>CC(C)NC[C@H](Oc1ccc(-c2ncnc3c2C(C)CC3)cc1)c1ccc(Cl)cc1.O=C(O)C(F)(F)F.?
|
[] |
|
The chemical reaction makes use of solvents Cc1ccccc1 and O=P(Cl)(Cl)Cl. ### The answer is Cc1ccccc1 and O=P(Cl)(Cl)Cl
|
Would you mind sharing the solvent medium in the reaction that corresponds to the SMILES O=P(Cl)(Cl)Cl.NC(=O)c1ccc(Br)cn1.[OH-].[Na+]>>N#Cc1ccc(Br)cn1.?
|
[] |
|
This reaction's solvents include CCOCC and c1ccncc1. ### The answer is CCOCC and c1ccncc1
|
In carrying out the reaction involving CCOCC.CC=CC=CCCCCCCCCC(=O)Cl.OCCCC1CC1>>CC=CC=CCCCCCCCCC(=O)OCCCC1CC1., what solvents were employed?
|
[] |
|
C1COCCN1 and ClCCl are utilized as the solvents in this chemical reaction. ### The answer is C1COCCN1 and ClCCl
|
Which solvents are involved in the reaction represented by the SMILES Cc1c(CN2CCN(c3nccnc3-c3ccc(CN)cc3)CC2)cnn1C.COCC(=O)Cl.C1COCCN1>>COCC(=O)NCc1ccc(-c2nccnc2N2CCN(Cc3cnn(C)c3C)CC2)cc1.?
|
[] |
|
The chemical reaction involves using Cc1ccccc1C as solvents. ### The answer is Cc1ccccc1C
|
Would you please tell me what solvent medium is used in the reaction corresponding to the SMILES CCCCc1nc2c(C)ccnc2n1Cc1ccc(-n2cc(Cl)c(Cl)c2C#N)cc1.C[Sn](C)(C)N=[N+]=[N-].[OH-].[Na+]>>CCCCc1nc2c(C)ccnc2n1Cc1ccc(-n2cc(Cl)c(Cl)c2-c2nnn[nH]2)cc1.?
|
[] |
|
The solvents, C1COCCO1, are utilized in this chemical reaction. ### The answer is C1COCCO1
|
Can you specify the solvent medium used for the reaction corresponding to the SMILES CC(C)(C)OC(=O)NCCNc1ccc(C#N)cn1.Cl>>Cl.Cl.N#Cc1ccc(NCCN)nc1.?
|
[] |
|
This chemical reaction utilizes CC(=O)O and O as its solvents. ### The answer is CC(=O)O and O
|
I would like to know the solvents in the reaction associated with the SMILES notation CCOC(=O)CC(c1ccc(OCc2cccc(-c3ccc(C(F)(F)F)cc3)c2)cc1)c1ccno1.O.Cl>>O=C(O)CC(c1ccc(OCc2cccc(-c3ccc(C(F)(F)F)cc3)c2)cc1)c1ccno1., could you tell me?
|
[] |
|
In this reaction, solvents CN(C)C=O and O are used. ### The answer is CN(C)C=O and O
|
What solvents are involved in the chemical reaction that is defined by COC(=O)c1c(Cl)cc(Cl)nc1C(F)(F)F.O.NN>>O=c1[nH][nH]c2cc(Cl)nc(C(F)(F)F)c12.?
|
[] |
|
This reaction's chemical process involves solvents C1CCOC1 and CCOC(C)=O. ### The answer is C1CCOC1 and CCOC(C)=O
|
What solvents can be found in the reaction denoted by the SMILES CCC(CC)c1cc(C)nn2c(-c3sc(Br)cc3Cl)c(C)nc12.C1CCOC1.Brc1cscn1>>CCC(CC)c1cc(C)nn2c(-c3sc(-c4cscn4)cc3Cl)c(C)nc12.?
|
[] |
|
This chemical process is carried out using solvents CCCCCC, CO, CS(C)=O, and ClCCl. ### The answer is CCCCCC, CO, CS(C)=O, and ClCCl
|
Can you tell me which solvents were used in the reaction involving the SMILES C[O-].[Na+].CO.O=S(=O)(Nc1c(Cl)cccc1Cl)c1nc2cc(Cl)cc(Cl)n2n1.CC(=O)O>>COc1cc(Cl)cc2nc(S(=O)(=O)Nc3c(Cl)cccc3Cl)nn12.?
|
[] |
|
C1CCOC1 and O are the solvents incorporated in this chemical reaction. ### The answer is C1CCOC1 and O
|
Can you name the solvents used in the reaction depicted by the SMILES code CCOC(CNC(=O)c1ccc(Br)cc1Cl)OCC.Cl.O>>O=CCNC(=O)c1ccc(Br)cc1Cl.?
|
[] |
|
ClCCl and O=C(O)C(F)(F)F are the solvents used in this chemical reaction. ### The answer is ClCCl and O=C(O)C(F)(F)F
|
Could you clarify which solvents are employed in the reaction represented by the SMILES syntax CC(C)NC(=O)c1cn(COCC[Si](C)(C)C)c2ncc(-c3nn(C)c4cc(F)cc(F)c34)nc12.O=C(O)C(F)(F)F>>CC(C)NC(=O)c1c[nH]c2ncc(-c3nn(C)c4cc(F)cc(F)c34)nc12.?
|
[] |
|
The reaction proceeds with C1CCOC1 as solvents. ### The answer is C1CCOC1
|
Which solvents were utilized in the chemical reaction involving Br[Mg]c1ccccc1.Clc1ccc2ccccc2n1>>c1ccc(-c2ccc3ccccc3n2)cc1.?
|
[] |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.