Hugging Face's logo

Datasets:
virx
/
molecule

Modalities:
Text
Formats:
json
Size:
10K - 100K
Libraries:
Datasets
pandas
Dataset card Data Studio Files
xet
Community
1
Dataset Viewer
Auto-converted to Parquet
instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_0>.
C=CCc1ccc(F)c(C)c1
What is the building block token for the following molecule?
C=CCc1ccc(F)c(C)c1
<BB_0>
What is the molecular formula for <BB_0>?
The molecular formula for <BB_0> (C=CCc1ccc(F)c(C)c1) is C10H11F.
Describe the ring structures in building block <BB_0>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_0>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_0>.
**Token:** <BB_0> **SMILES:** C=CCc1ccc(F)c(C)c1 **Molecular Formula:** C10H11F **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1>.
CC(C)(c1ccc(C=O)cc1)C(F)(F)F
What is the building block token for the following molecule?
CC(C)(c1ccc(C=O)cc1)C(F)(F)F
<BB_1>
What is the molecular formula for <BB_1>?
The molecular formula for <BB_1> (CC(C)(c1ccc(C=O)cc1)C(F)(F)F) is C11H11F3O.
Describe the ring structures in building block <BB_1>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1>.
**Token:** <BB_1> **SMILES:** CC(C)(c1ccc(C=O)cc1)C(F)(F)F **Molecular Formula:** C11H11F3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2>.
CCNC(=O)NC(C)(C)C(=O)O
What is the building block token for the following molecule?
CCNC(=O)NC(C)(C)C(=O)O
<BB_2>
What is the molecular formula for <BB_2>?
The molecular formula for <BB_2> (CCNC(=O)NC(C)(C)C(=O)O) is C7H14N2O3.
Describe the ring structures in building block <BB_2>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_2>.
**Token:** <BB_2> **SMILES:** CCNC(=O)NC(C)(C)C(=O)O **Molecular Formula:** C7H14N2O3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_3>.
CC(C)(C)c1ccc(S(=O)(=O)NCCC(=O)O)cc1
What is the building block token for the following molecule?
CC(C)(C)c1ccc(S(=O)(=O)NCCC(=O)O)cc1
<BB_3>
What is the molecular formula for <BB_3>?
The molecular formula for <BB_3> (CC(C)(C)c1ccc(S(=O)(=O)NCCC(=O)O)cc1) is C13H19NO4S.
Describe the ring structures in building block <BB_3>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_3>.
**Token:** <BB_3> **SMILES:** CC(C)(C)c1ccc(S(=O)(=O)NCCC(=O)O)cc1 **Molecular Formula:** C13H19NO4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_4>.
COC(=O)c1cc(Br)ccc1C
What is the building block token for the following molecule?
COC(=O)c1cc(Br)ccc1C
<BB_4>
What is the molecular formula for <BB_4>?
The molecular formula for <BB_4> (COC(=O)c1cc(Br)ccc1C) is C9H9BrO2.
Describe the ring structures in building block <BB_4>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_4>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_4>.
**Token:** <BB_4> **SMILES:** COC(=O)c1cc(Br)ccc1C **Molecular Formula:** C9H9BrO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_5>.
COC(=O)C(N)C(O)C(C)C.Cl
What is the building block token for the following molecule?
COC(=O)C(N)C(O)C(C)C.Cl
<BB_5>
What is the molecular formula for <BB_5>?
The molecular formula for <BB_5> (COC(=O)C(N)C(O)C(C)C.Cl) is C7H16ClNO3.
Describe the ring structures in building block <BB_5>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_5>.
The molecule contains the following groups: Amine, Ester, Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_5>.
**Token:** <BB_5> **SMILES:** COC(=O)C(N)C(O)C(C)C.Cl **Molecular Formula:** C7H16ClNO3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Ester, Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_6>.
Cn1cc(C=O)c(-c2ccccc2)n1
What is the building block token for the following molecule?
Cn1cc(C=O)c(-c2ccccc2)n1
<BB_6>
What is the molecular formula for <BB_6>?
The molecular formula for <BB_6> (Cn1cc(C=O)c(-c2ccccc2)n1) is C11H10N2O.
Describe the ring structures in building block <BB_6>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_6>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_6>.
**Token:** <BB_6> **SMILES:** Cn1cc(C=O)c(-c2ccccc2)n1 **Molecular Formula:** C11H10N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_7>.
CN(C1CCCCC1)C1CCCCC1
What is the building block token for the following molecule?
CN(C1CCCCC1)C1CCCCC1
<BB_7>
What is the molecular formula for <BB_7>?
The molecular formula for <BB_7> (CN(C1CCCCC1)C1CCCCC1) is C13H25N.
Describe the ring structures in building block <BB_7>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_7>.
The molecule contains the following groups: Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_7>.
**Token:** <BB_7> **SMILES:** CN(C1CCCCC1)C1CCCCC1 **Molecular Formula:** C13H25N **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine
Provide the SMILES representation for the building block token <BB_8>.
C#CCC1(C(=O)Cl)CCCCC1
What is the building block token for the following molecule?
C#CCC1(C(=O)Cl)CCCCC1
<BB_8>
What is the molecular formula for <BB_8>?
The molecular formula for <BB_8> (C#CCC1(C(=O)Cl)CCCCC1) is C10H13ClO.
Describe the ring structures in building block <BB_8>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_8>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8>.
**Token:** <BB_8> **SMILES:** C#CCC1(C(=O)Cl)CCCCC1 **Molecular Formula:** C10H13ClO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9>.
CCn1nccc1C1CCNCC1
What is the building block token for the following molecule?
CCn1nccc1C1CCNCC1
<BB_9>
What is the molecular formula for <BB_9>?
The molecular formula for <BB_9> (CCn1nccc1C1CCNCC1) is C10H17N3.
Describe the ring structures in building block <BB_9>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_9>.
**Token:** <BB_9> **SMILES:** CCn1nccc1C1CCNCC1 **Molecular Formula:** C10H17N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_10>.
CCCCC(=CCO)CCCC
What is the building block token for the following molecule?
CCCCC(=CCO)CCCC
<BB_10>
What is the molecular formula for <BB_10>?
The molecular formula for <BB_10> (CCCCC(=CCO)CCCC) is C11H22O.
Describe the ring structures in building block <BB_10>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_10>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_10>.
**Token:** <BB_10> **SMILES:** CCCCC(=CCO)CCCC **Molecular Formula:** C11H22O **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_11>.
CC(F)(F)CCCO
What is the building block token for the following molecule?
CC(F)(F)CCCO
<BB_11>
What is the molecular formula for <BB_11>?
The molecular formula for <BB_11> (CC(F)(F)CCCO) is C5H10F2O.
Describe the ring structures in building block <BB_11>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_11>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_11>.
**Token:** <BB_11> **SMILES:** CC(F)(F)CCCO **Molecular Formula:** C5H10F2O **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_12>.
CCC(=O)c1ccc(Cl)c(S(=O)(=O)Cl)c1
What is the building block token for the following molecule?
CCC(=O)c1ccc(Cl)c(S(=O)(=O)Cl)c1
<BB_12>
What is the molecular formula for <BB_12>?
The molecular formula for <BB_12> (CCC(=O)c1ccc(Cl)c(S(=O)(=O)Cl)c1) is C9H8Cl2O3S.
Describe the ring structures in building block <BB_12>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_12>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_12>.
**Token:** <BB_12> **SMILES:** CCC(=O)c1ccc(Cl)c(S(=O)(=O)Cl)c1 **Molecular Formula:** C9H8Cl2O3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_13>.
COCC1(N)CCC(F)(F)CC1.Cl
What is the building block token for the following molecule?
COCC1(N)CCC(F)(F)CC1.Cl
<BB_13>
What is the molecular formula for <BB_13>?
The molecular formula for <BB_13> (COCC1(N)CCC(F)(F)CC1.Cl) is C8H16ClF2NO.
Describe the ring structures in building block <BB_13>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_13>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_13>.
**Token:** <BB_13> **SMILES:** COCC1(N)CCC(F)(F)CC1.Cl **Molecular Formula:** C8H16ClF2NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_14>.
Cn1c(N2CCNCC2)nc(Cl)c1C#N
What is the building block token for the following molecule?
Cn1c(N2CCNCC2)nc(Cl)c1C#N
<BB_14>
What is the molecular formula for <BB_14>?
The molecular formula for <BB_14> (Cn1c(N2CCNCC2)nc(Cl)c1C#N) is C9H12ClN5.
Describe the ring structures in building block <BB_14>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_14>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_14>.
**Token:** <BB_14> **SMILES:** Cn1c(N2CCNCC2)nc(Cl)c1C#N **Molecular Formula:** C9H12ClN5 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_15>.
CC1Cc2cccc(CN)c2N1
What is the building block token for the following molecule?
CC1Cc2cccc(CN)c2N1
<BB_15>
What is the molecular formula for <BB_15>?
The molecular formula for <BB_15> (CC1Cc2cccc(CN)c2N1) is C10H14N2.
Describe the ring structures in building block <BB_15>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_15>.
The molecule contains the following groups: Amine, Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_15>.
**Token:** <BB_15> **SMILES:** CC1Cc2cccc(CN)c2N1 **Molecular Formula:** C10H14N2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine
Provide the SMILES representation for the building block token <BB_16>.
Fc1ccc(CCN2CCNCC2)cc1
What is the building block token for the following molecule?
Fc1ccc(CCN2CCNCC2)cc1
<BB_16>
What is the molecular formula for <BB_16>?
The molecular formula for <BB_16> (Fc1ccc(CCN2CCNCC2)cc1) is C12H17FN2.
Describe the ring structures in building block <BB_16>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
End of preview. Expand in Data Studio

No dataset card yet

Downloads last month
18
Size of downloaded dataset files:
11.6 MB
Size of the auto-converted Parquet files:
1.61 MB
Number of rows:
60,105